 | This article is rated Start-class on Wikipedia's content assessment scale. It is of interest to the following WikiProjects: | ||||||||||
| |||||||||||
Untitled
editFascinating, but a couple of questions that might be relevant:
- Does it occur naturally? Where?
- Is it used industrially? Where?
- How is it produced (both naturally and industrially)?
- Is it particularly toxic?
- If anyone needs it, the unique SMILES formula for this molecule is CC1=CN([C@H]2CC(O)[C@@H](CO)O2)C(=O)NC1=O