Wikipedia:WikiProject Pharmacology/Log/2009-08-06

Standard header for logs from CheMoBot

00:53:39 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'error' ('' -> 'empty')
00:53:40 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'boxname' ('drugbox' -> '')
00:53:40 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'image' ('Moxifloxacin skeletal.svg' -> '')
00:53:40 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'image2' ('Moxifloxacin-cation-from-xtal-3D-balls.png' -> '')
00:53:40 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'ChemSpiderID' ('134802' -> '')
00:53:41 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'F' ('1' -> '')
00:53:41 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'bioavailability' ('86 to 92%' -> '')
00:53:41 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'protein_bound' ('30 to 50%' -> '')
00:53:42 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'metabolism' ('[[Glucuronide]] and [[sulfate]] conjugation [[Cytochrome P450]] system not involved' -> '')
00:53:42 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'elimination_half-life' ('12 [[hour]]s' -> '')
00:53:42 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'excretion' ('hepatic' -> '')
00:53:43 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'pregnancy_category' ('C ([[United States|US]]) B3 ([[Australia]])' -> '')
00:53:43 (1, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'legal_status' ('[[Prescription Only]]' -> '')
00:53:43 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'IUPAC_name' ('1-cyclopropyl-7-[(1S,6S)-2,8-diazabicyclo[4.3.0]non-8-yl]-6-fluoro-8-methoxy-4-oxo-quinoline-3-carboxylic acid' -> '')
00:53:43 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'molecular_weight' ('401.431 [[Gram|g]]/[[Mole (unit)|mol]]' -> '')
00:53:44 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'DrugBank' ('APRD00281' -> '')
00:53:44 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'ATC_prefix' ('J01' -> '')
00:53:44 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'ATC_suffix' ('MA14' -> '')
00:53:45 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'ATC_supplemental' ('{{ATC|S01|AX22}}' -> '')
00:53:45 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'smiles' ('COc1c(N2CC3NCCCC3C2)c(F)cc2c(=O)c(cn(C3CC3)c12)C(=O)O' -> '')
00:53:45 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'C' ('21' -> '')
00:53:46 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'H' ('24' -> '')
00:53:46 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'N' ('3' -> '')
00:53:46 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'O' ('4' -> '')
00:53:47 (2, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'PubChem' ('152946' -> '')
00:53:47 (3, 1, 3) (EDIT) User:68.237.88.113 (contribs, talk) edited Moxifloxacin (diff, hist)
Changed: 'CAS_number' ('354812-41-2' -> '')
00:54:29 (0, 0, 2) (EDIT) User:Brianga (contribs, talk) edited Moxifloxacin (diff, hist)
Added links: http://www.herald.ie/national-news/warning-over-two-types-of-antibiotic-1445498.html, http://www.mhra.gov.uk/home/groups/pl-p/documents/websiteresources/con014103.pdf, http://www.drugbank.ca/drugs/DB00218, http://www.rtialert.com/pdf/dhpl.pdf, http://www.akdae.de/20/40/20090119.pdf, http://www.patentlens.net/patentlens/search_ajax.cgi?patnum=US/7115744, http://www.drugpatentwatch.com/premium/preview/NDA/index.php?021085, http://www.pharmacytimes.com/issues/articles/2008-05_003.asp, http://www.reuters.com/article/rbssHealthcareNews/idUSL2453307820080724, http://www.accessdata.fda.gov/drugsatfda_docs/nda/99/21-085_Avelox.cfm, http://www.fda.gov/ohrms/dockets/ac/99/transcpt/3558t2.rtf, http://uk.reuters.com/article/governmentFilingsNews/idUKL2453307820080724, http://www.tballiance.org/newscenter/view-innews.php?id=157, http://www.accessdata.fda.gov/drugsatfda_docs/appletter/1999/21085ltr.pdf, http://uk.reuters.com/article/governmentFilingsNews/idUKL2453307820080724, http://www.akdae.de/20/40/20090119.pdf., http:
04:17:40 (0, 0, 2) (EDIT) User:24.128.189.223 (contribs, talk) edited Olanzapine (diff, hist)
Added links: http://files.shareholder.com/downloads/LLY/696621960x0x296463/611E167A-61C9-4C03-8866-ACF5FA7C8953/English.PDF
08:37:28 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'IUPAC_name' ('8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]- 8-azaspiro[4.5]decane-7,9-dione' -> '')
08:37:29 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'molecular_weight' ('385.50314 g/mol' -> '')
08:37:29 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'DrugBank' ('APRD00222' -> '')
08:37:29 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'ATC_prefix' ('N05' -> '')
08:37:30 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'ATC_suffix' ('BE01' -> '')
08:37:30 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'C' ('21' -> '')
08:37:30 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'H' ('31' -> '')
08:37:30 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'N' ('5' -> '')
08:37:31 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'O' ('2' -> '')
08:37:31 (2, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'PubChem' ('2477' -> '')
08:37:31 (3, 1, 2) (EDIT) User:VolkovBot (contribs, talk) edited Buspirone (diff, hist)
Changed: 'CAS_number' ('36505-84-7' -> '')
10:05:32 (2, 1, 2) (EDIT) User:Anypodetos (contribs, talk) edited Sodium_laurilsulfate (diff, hist)
Changed: 'IUPAC_name' ('Sodium alkyl sulfates' -> '')
10:05:33 (2, 1, 2) (EDIT) User:Anypodetos (contribs, talk) edited Sodium_laurilsulfate (diff, hist)
Changed: 'molecular_weight' ('â288.4 g/mol' -> '')
10:05:34 (2, 1, 2) (EDIT) User:Anypodetos (contribs, talk) edited Sodium_laurilsulfate (diff, hist)
Changed: 'ATC_prefix' ('A06' -> '')
10:05:34 (2, 1, 2) (EDIT) User:Anypodetos (contribs, talk) edited Sodium_laurilsulfate (diff, hist)
Changed: 'ATC_suffix' ('AG11' -> '')
11:18:46 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Piritramide (diff, hist)
Changed: 'ATC_prefix' ('' -> 'N02')
11:18:46 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Piritramide (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AC03')
11:19:51 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Piroheptine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:21:51 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pirolazamide (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:22:27 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pivoxazepam (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:29:10 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Ponazuril (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:30:06 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pradofloxacin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:31:00 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pramiconazole (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:32:48 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pramiracetam (diff, hist)
Changed: 'ATC_prefix' ('' -> 'N06')
11:32:48 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pramiracetam (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BX16')
11:34:38 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pranoprofen (diff, hist)
Changed: 'ATC_prefix' ('' -> 'S01')
11:34:38 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pranoprofen (diff, hist)
Changed: 'ATC_suffix' ('' -> 'BC09')
11:35:31 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Prasugrel (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:36:23 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Pravadoline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:37:06 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Prazitone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:37:57 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Preladenant (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:38:21 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Premazepam (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:38:46 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Priliximab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:39:51 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Probarbital (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:42:24 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Procaterol (diff, hist)
Changed: 'ATC_prefix' ('' -> 'R03')
11:42:25 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Procaterol (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AC16')
11:42:25 (2, 1, 1) (EDIT) User:Anypodetos (contribs, talk) edited Procaterol (diff, hist)
Changed: 'ATC_supplemental' ('' -> '{{ATC|R03|CC08}}')
12:42:33 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Changed: 'IUPAC_name' ('1-(2,3-Dihydro-1H-inden-5-yl)propan-2-amine' -> '1-(2,3-dihydro-1H-inden-5-yl)propan-2-amine')
12:46:30 (0, 0, 2) (EDIT) User:Nuklear (contribs, talk) edited RTI-113 (diff, hist)
Added links: http://jpet.aspetjournals.org/cgi/content/full/314/2/575
13:18:57 (0, 0, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Napthylaminopropane (diff, hist)
Added links: http://link.springer.de/link/service/journals/00213/bibs/7133003/71330309.htm
13:24:19 (2, 1, 1) (EDIT) User:Edgar181 (contribs, talk) edited Methylhexanamine (diff, hist)
Changed: 'DrugBank' ('?' -> '')
13:24:20 (2, 1, 1) (EDIT) User:Edgar181 (contribs, talk) edited Methylhexanamine (diff, hist)
Changed: 'ATC_prefix' ('?' -> '')
13:24:20 (2, 1, 1) (EDIT) User:Edgar181 (contribs, talk) edited Methylhexanamine (diff, hist)
Changed: 'ATC_suffix' ('?' -> '')
13:26:43 (0, 0, 2) (EDIT) User:Selenamiler (contribs, talk) edited Lactulose (diff, hist)
Added links: http://www.rxhealthdrugs.com/brand/260/342/duphalac-lactulose
13:34:53 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Changed: 'ATC_prefix' ('none' -> '')
13:59:12 (0, 0, 2) (EDIT) User:121.208.32.240 (contribs, talk) edited Trastuzumab (diff, hist)
Added links: http://www.health.gov.au/internet/main/publishing.nsf/Content/herceptin-govtdecision.htm
13:59:43 (0, 0, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Added links: http://www.usdoj.gov/dea/programs/forensicsci/microgram/journal_v3/mj05_v3_pg1.html, http://www.usdoj.gov/dea/programs/forensicsci/microgram/journal_v3/mj05_v3_pg1.html, http://www.bluelight.ru/vb/showthread.php?t=91142, http://www.bluelight.ru/vb/showthread.php?t=97013
14:01:27 (0, 0, 2) (EDIT) User:Newmatt3 (contribs, talk) edited Naratriptan (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/druginfo/meds/a601083.html, http://dx.doi.org/10.1016/S0149-2918(00)80068-5, http://dx.doi.org/10.1016/S0149-2918(00)80068-5
14:02:49 (0, 0, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Added links: http://www.erowid.org/chemicals/iap/iap.shtml, http://www.erowid.org/experiences/subs/exp_IAP.shtml
14:04:42 (0, 0, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Added links: http://designer-drugs.com/pte/12.162.180.114/dcd/chemistry/iap.html
14:12:38 (0, 0, 2) (EDIT) User:Lyrl (contribs, talk) edited Venlafaxine (diff, hist)
Added links: http://www.fda.gov/Safety/MedWatch/SafetyInformation/SafetyAlertsforHumanMedicalProducts/ucm150546.htm
14:14:06 (0, 0, 2) (EDIT) User:Lyrl (contribs, talk) edited Varenicline (diff, hist)
Added links: http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/2006/ucm108651.htm
14:15:23 (0, 0, 2) (EDIT) User:Lyrl (contribs, talk) edited Vardenafil (diff, hist)
Added links: http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/2007/ucm109012.htm
14:32:58 (0, 0, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Indanylaminopropane (diff, hist)
Added links: http://designer-drug.com/pte/12.162.180.114/dcd/chemistry/iap.madmax.html
17:52:00 (0, 0, 2) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Added links: http://dx.doi.org/10.1016/j.ejphar.2008.04.008, http://dx.doi.org/10.1021/jm00374a001, http://dx.doi.org/10.1021/jm00391a028, http://dx.doi/org/10.1021/jm00172a018
17:54:10 (0, 0, 2) (EDIT) User:69.112.244.146 (contribs, talk) edited Quetiapine (diff, hist)
Added links: http://http://content.nejm.org/cgi/content/full/353/12/1209
19:29:30 (0, 0, 2) (EDIT) User:FV alternate (contribs, talk) edited User:Fvasconcellos/Retigabine (diff, hist)
Added links: http://www.valeant.com/products/pipeline/neurology.jsp
20:00:50 (0, 0, 2) (EDIT) User:212.87.185.122 (contribs, talk) edited Tramadol (diff, hist)
Added links: http://tramadol.tk
20:05:20 (0, 0, 2) (EDIT) User:78.16.97.161 (contribs, talk) edited Tadalafil (diff, hist)
Added links: http://ehs.lilly.com/msds/msds_tadalafil_tablets.pdf
20:18:44 (2, 1, 2) (EDIT) User:JÃ¼ (contribs, talk) edited Levobunolol (diff, hist)
Changed: 'IUPAC_name' ('5-{[(2''S'')-3-(''tert''-butylamino)-2-hydroxypropyl]oxy}-3,4-dihydronaphthalen-1(2''H'')-one' -> '(''S'')-5-{[3-(''tert''-butylamino)-2-hydroxypropyl]oxy}-3,4-dihydronaphthalen-1(2''H'')-one')