<- User:Beetstra/listing20 - User:Beetstra/Validation - User:Beetstra/listing22 ->

Data

5001 to 5050

Glyceraldehyde_3-phosphate (5001)
```
Botcommand: addindex 364702043 Glyceraldehyde_3-phosphate
```
```
For index : Glyceraldehyde_3-phosphate=364702043
```
* 142-10-9 -> 142-10-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Glyceraldehyde+phosphate found on commonchemistry - Glyceraldehyde+phosphate
* 9001-50-7 (exact match)
Name in list

All names: 11: PN: CN101140240 PAGE: 2 claimed sequence, 3-Phosphoglyceraldehyde dehydrogenase, Antigens, TLA-b (thermolabile antigen b), [[Dehydrogenase, glyceraldehyde phosphate]], Dehydrogenase, Glycerinaldehydphosphat, deshidrogenasa, gliceraldehido fosfato, deshydrogenase, phosphate de glyceraldehyde, E.C. 1.2.1.12, Glyceraldehyde 3-phosphate dehydrogenase, [[glyceraldehyde phosphate dehydrogenase]], [[glyceraldehyde phosphate dehydrogenase (NAD)]], Glyceraldehyde-3-P-dehydrogenase, Glyceraldehyde-3-phosphate dehydrogenase (NAD), [[NAD-dependent glyceraldehyde phosphate dehydrogenase]], NAD-Dependent phosphorylating glyceraldehyde-3-phosphate dehydrogenase, [[NADH-glyceraldehyde phosphate dehydrogenase]], Phosphoglyceraldehyde dehydrogenase, TLA-b antigens, Triose phosphate dehydrogenase

* ChemSpiderID: 709 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 729

* No InChI - (ChemSpider: | InChI=InChI=1/C3H7O6P/c4-1-3(5)2-9-10(6,7)8/h1,3,5H,2H2,(H2,6,7,8) )

* SMILES: C(C(C=O)O)OP(=O)(O)O - (ChemSpider: | SMILES=O=P(O)(O)OCC(O)C=O )
Glycerol_monostearate (5005)
```
Botcommand: addindex 352467800 Glycerol_monostearate
```
```
For index : Glycerol_monostearate=352467800
```
* 123-94-4 -> 123-94-4 - NOT VERIFIED

* CAS found on commonchemistry - 123-94-4 - name in list
All names: (.+-.)-2,3-Dihydroxypropyl octadecanoate, 1-Glyceryl stearate, 1-Monooctadecanoylglycerol, 1-Monostearin, 1-Monostearoylglycerol, 1-monostearoyl-rac-glycerol, 2,3-Dihydroxypropyl octadecanoate, 3-Stearoyloxy-1,2-propanediol, Aldo 33, Aldo 75, Aldo MSD, Aldo MSLG, Emerest 2407, estearato de glicerol, puro, Glycerin 1-monostearate, Glycerin 1-stearate, GLYCERIN-1-MONOSTEARAT, Glycerin-1-stearat, Glycerol 1-monostearate, Glycerol 1-stearate, GLYCEROL MONOSTEARATE, glycerol stearate, Glycerol Î±-monostearate, Glyceryl 1-monostearate, Glyceryl 1-octadecanoate, NSC 3875, Octadecanoic acid 2,3-dihydroxypropyl ester, Octadecanoic acid, 2,3-dihydroxypropyl ester, Sandin EU, Stearate de glycerol, STEARATE, 2,3-DIHYDROXYPROP-1-YL, STEARATE, 2,3-DIHYDROXYPROPYL, Stearic acid 1-monoglyceride, Stearic acid Î±-monoglyceride, Stearin, 1-mono-, Tegin 55G, Î±-Monostearin

* Glycerol+monostearate found on commonchemistry - Glycerol+monostearate
* 123-94-4 (Formula: C21H42O4; Name: Octadecanoic acid, 2,3-dihydroxypropyl ester) Matches CAS (123-94-4) on page

* 31566-31-1 (Formula: C21H42O4; Name: Octadecanoic acid, monoester with 1,2,3-propanetriol)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Glycin (5010)
```
Botcommand: addindex 276022832 Glycin
```
```
For index : Glycin=276022832
```
* 122-87-2 -> 122-87-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycin found on commonchemistry - Glycin
* 56-40-6 (Formula: C2H5NO2; Name: Glycine)

* 50-56-6 (Formula: C43H66N12O12S2; Name: Oxytocin)

* 50-57-7 (Formula: C46H65N13O12S2; Name: Vasopressin, 8-L-lysine-)

* 57-00-1 (Formula: C4H9N3O2; Name: Glycine, N-(aminoiminomethyl)-N-methyl-)

* 60-00-4 (Formula: C10H16N2O8; Name: Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-)

* 61-78-9 (Formula: C9H10N2O3; Name: Glycine, N-(4-aminobenzoyl)-)

* 62-33-9 (Formula: C10H12CaN2O8.2Na; Name: Calciate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-ÎºO)methyl]glycinato-ÎºN,ÎºO]](4-)]-, disodium, (OC-6-21)-)

* 62-57-7 (Formula: C4H9NO2; Name: Alanine, 2-methyl-)

* 64-02-8 (Formula: C10H16N2O8.4Na; Name: Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrasodium salt)

* 67-07-2 (Formula: C4H10N3O5P; Name: Glycine, N-[imino(phosphonoamino)methyl]-N-methyl-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OC(CNC1=CC=C(O)C=C1)=O
Glycine_betaine_aldehyde (5012)
```
Botcommand: addindex 355594113 Glycine_betaine_aldehyde
```
```
For index : Glycine_betaine_aldehyde=355594113
```
* 7418-61-3 -> 7418-61-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycine+betaine+aldehyde not found on commonchemistry - Glycine+betaine+aldehyde

* ChemSpiderID: 244 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 249

* InChI: 1/C5H12NO/c1-6(2,3)4-5-7/h5H,4H2,1-3H3/q+1 - (ChemSpider: | InChI=InChI=1/C5H12NO/c1-6(2,3)4-5-7/h5H,4H2,1-3H3/q+1 )

* SMILES: O=CC[N+](C)(C)C - (ChemSpider: | SMILES=O=CC[N+](C)(C)C )
Glycineamide_ribonucleotide (5013)
```
Botcommand: addindex 280244659 Glycineamide_ribonucleotide
```
```
For index : Glycineamide_ribonucleotide=280244659
```
* 10074-18-7 -> 10074-18-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycineamide+ribonucleotide not found on commonchemistry - Glycineamide+ribonucleotide

* No ChemSpiderID

* PubChem: 160913

* No InChI

* SMILES: C([C@@H]1[C@H]([C@H]([C@@H](O1)NC(=O)CN)O)O)OP(=O)(O)O
Glycitein (5014)
```
Botcommand: addindex 350355502 Glycitein
```
```
For index : Glycitein=350355502
```
* 40957-83-3 -> 40957-83-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycitein not found on commonchemistry - Glycitein

* No ChemSpiderID

* PubChem: 5317750

* No InChI

* SMILES: COC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O)O
Glyclopyramide (5015)

* No CASNo

* Glyclopyramide not found on commonchemistry - Glyclopyramide

* No ChemSpiderID

* PubChem: 71793

* No InChI

* No SMILES
Glycobiarsol (5016)
```
Botcommand: addindex 306112027 Glycobiarsol
```
```
For index : Glycobiarsol=306112027
```
* 116-49-4 -> 116-49-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycobiarsol not found on commonchemistry - Glycobiarsol

* No ChemSpiderID

* PubChem: 16682839

* No InChI

* No SMILES
Glycochenodeoxycholic_acid (5017)

* No CASNo

* Glycochenodeoxycholic+acid not found on commonchemistry - Glycochenodeoxycholic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Glycocyamine (5019)
```
Botcommand: addindex 355942806 Glycocyamine
```
```
For index : Glycocyamine=355942806
```
* 352-97-6 -> 352-97-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycocyamine not found on commonchemistry - Glycocyamine

* No ChemSpiderID

* PubChem: 763

* No InChI

* SMILES: C(C(=O)O)N=C(N)N
Glycodeoxycholic_acid (5020)

* No CASNo

* Glycodeoxycholic+acid not found on commonchemistry - Glycodeoxycholic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Glycol_stearate (5021)
```
Botcommand: addindex 358658195 Glycol_stearate
```
```
For index : Glycol_stearate=358658195
```
* 111-60-4 -> 111-60-4 - NOT VERIFIED

* CAS found on commonchemistry - 111-60-4 - name in list
All names: 2-hydroxyethyl stearate, 2-Hydroxyethylstearat, Cutina EGMS, Emcol ES 50, Emerest 2350, Empilan 2848, estearato de 2-hidroxietilo, ETHYLENE GLYCOL MONOSTEARATE, Ethylene glycol stearate, Glycol monostearate, Glycol stearate, Ivorit, Kessco EGMS, Kessco EGMS 70, Monthybase, Monthyle, Nikkol EGMS 70, Octadecanoic acid 2-hydroxyethyl ester, Octadecanoic acid, 2-hydroxyethyl ester, Parastarin, Prodhybas N, Prodhybase ethyl, S 151, Sedetol, Stearate de 2-hydroxyethyle, STEARATE, 2-HYDROXYETHYL, Stearic acid, 2-hydroxyethyl ester, Tegin EGMS-VA, Tego-stearate

* Glycol+stearate found on commonchemistry - Glycol+stearate
* 111-60-4 (Formula: C20H40O3; Name: Octadecanoic acid, 2-hydroxyethyl ester) Matches CAS (111-60-4) on page

* 142-75-6 (Formula: C21H42O3; Name: Octadecanoic acid, 2-hydroxypropyl ester)

* 9004-99-3 (Formula: (C2H4O)nC18H36O2; Name: Poly(oxy-1,2-ethanediyl), Î±-(1-oxooctadecyl)-Ï‰-hydroxy-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(OCCO)CCCCCCCCCCCCCCCCC
Glycolonitrile (5024)
```
Botcommand: addindex 363723321 Glycolonitrile
```
```
For index : Glycolonitrile=363723321
```
* 107-16-4 -> 107-16-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycolonitrile not found on commonchemistry - Glycolonitrile

* No ChemSpiderID

* PubChem: 7857

* No InChI

* SMILES: C(C#N)O
Glycyrrhizol (5028)
```
Botcommand: addindex 270987590 Glycyrrhizol
```
```
For index : Glycyrrhizol=270987590
```
* 877373-00-7 -> 877373-00-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Glycyrrhizol not found on commonchemistry - Glycyrrhizol

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C/C(C)=C/CC4=CC1=C(C=C4O)OC3=C1COC2=CC(O)=C(C/C=C(C)/C)C(OC)=C23
Goitrin (5033)
```
Botcommand: addindex 356551158 Goitrin
```
```
For index : Goitrin=356551158
```
* 13190-34-6 -> 13190-34-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Goitrin not found on commonchemistry - Goitrin

* No ChemSpiderID

* PubChem: 3034683

* No InChI

* SMILES: C=CC1CNC(=S)O1
Gold(I)_bromide (5034)
```
Botcommand: addindex 360866611 Gold(I)_bromide
```
```
For index : Gold(I)_bromide=360866611
```
* 10294-27-6 -> 10294-27-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+I+bromide not found on commonchemistry - Gold+I+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(I)_chloride (5035)
```
Botcommand: addindex 364128428 Gold(I)_chloride
```
```
For index : Gold(I)_chloride=364128428
```
* 10294-29-8 -> 10294-29-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+I+chloride not found on commonchemistry - Gold+I+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(I,III)_chloride (5036)
```
Botcommand: addindex 285345346 Gold(I,III)_chloride
```
```
For index : Gold(I,III)_chloride=285345346
```
* 62792-24-9 -> 62792-24-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+I+III+chloride not found on commonchemistry - Gold+I+III+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(III)_bromide (5037)
```
Botcommand: addindex 365155794 Gold(III)_bromide
```
```
For index : Gold(III)_bromide=365155794
```
* 10294-28-7 -> 10294-28-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+III+bromide not found on commonchemistry - Gold+III+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(III)_fluoride (5039)
```
Botcommand: addindex 362298709 Gold(III)_fluoride
```
```
For index : Gold(III)_fluoride=362298709
```
* 14720-21-9 -> 14720-21-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+III+fluoride not found on commonchemistry - Gold+III+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(III)_hydroxide (5040)
```
Botcommand: addindex 352190796 Gold(III)_hydroxide
```
```
For index : Gold(III)_hydroxide=352190796
```
* 1303-52-2 -> 1303-52-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+III+hydroxide not found on commonchemistry - Gold+III+hydroxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(III)_oxide (5041)
```
Botcommand: addindex 350820928 Gold(III)_oxide
```
```
For index : Gold(III)_oxide=350820928
```
* 1303-58-8 -> 1303-58-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+III+oxide not found on commonchemistry - Gold+III+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gold(V)_fluoride (5042)
```
Botcommand: addindex 364248219 Gold(V)_fluoride
```
```
For index : Gold(V)_fluoride=364248219
```
* 57542-85-5 -> 57542-85-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Gold+V+fluoride not found on commonchemistry - Gold+V+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Golimumab (5043)
```
Botcommand: addindex 352283451 Golimumab
```
```
For index : Golimumab=352283451
```
* 476181-74-5 -> 476181-74-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Golimumab not found on commonchemistry - Golimumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gomiliximab (5044)
```
Botcommand: addindex 353769281 Gomiliximab
```
```
For index : Gomiliximab=353769281
```
* 357613-86-6 -> 357613-86-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Gomiliximab not found on commonchemistry - Gomiliximab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gonane (5045)
```
Botcommand: addindex 361245199 Gonane
```
```
For index : Gonane=361245199
```
* 4732-76-7 -> 4732-76-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Gonane not found on commonchemistry - Gonane

* No ChemSpiderID

* PubChem: 1108

* No InChI

* SMILES: [H][C@@]12[C@](CCC2)([H])[C@]3([H])CCC4CCCC[C@]4([H])[C@@]3([H])CC1
Goserelin (5046)
* No CASNo

* Goserelin found on commonchemistry - Goserelin
* 65807-02-5 (exact match)
Name in list

All names: [[1-9-Luteinizing hormone-releasing factor (swine), 6-[O-(1,1-dimethylethyl)-D-serine]-, 2-(aminocarbonyl)hydrazide]], Decapeptide I, [[goserelin]], ICI 118630, [[Luteinizing hormone-releasing factor (pig), 6-[O-(1,1-dimethylethyl)-D-serine]-10-deglycinamide-, 2-(aminocarbonyl)hydrazide]], Zoladex

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gossypetin (5047)
```
Botcommand: addindex 350556051 Gossypetin
```
```
For index : Gossypetin=350556051
```
* 489-35-0 -> 489-35-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Gossypetin not found on commonchemistry - Gossypetin

* No ChemSpiderID

* PubChem: 5280647

* No InChI

* SMILES: C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O
Gramicidin (5049)
```
Botcommand: addindex 356739325 Gramicidin
```
```
For index : Gramicidin=356739325
```
* 1405-97-6 -> 1405-97-6 - NOT VERIFIED

* CAS found on commonchemistry - 1405-97-6 - name in list
All names: Gramicidin, gramicidina, gramicidine, Gramicidins, Gramoderm

* Gramicidin found on commonchemistry - Gramicidin
* 1405-97-6 (exact match) Matches CAS (1405-97-6) on page
Name in list

All names: [[gramicidin]], [[gramicidina]], [[gramicidine]], [[gramicidins]], Gramoderm

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Gramicidin_S (5050)
```
Botcommand: addindex 363273478 Gramicidin_S
```
```
For index : Gramicidin_S=363273478
```
* 113-73-5 -> 113-73-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Gramicidin+S not found on commonchemistry - Gramicidin+S

* No ChemSpiderID

* PubChem: 73357

* No InChI

* No SMILES

5051 to 5100

Gramine (5051)
```
Botcommand: addindex 351757309 Gramine
```
```
For index : Gramine=351757309
```
* 87-52-5 -> 87-52-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Gramine not found on commonchemistry - Gramine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CN(C)CC2=CN C1=CC=CC=C12
Grandinin (5052)
```
Botcommand: addindex 343595030 Grandinin
```
```
For index : Grandinin=343595030
```
* 115166-32-0 -> 115166-32-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Grandinin not found on commonchemistry - Grandinin

* No ChemSpiderID

* PubChem: 492392

* No InChI

* SMILES: C1C2C(C3C4C(C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)C8(C(C(C(O8)CO)O)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O
Grandisol (5053)
```
Botcommand: addindex 355955220 Grandisol
```
```
For index : Grandisol=355955220
```
* 28117-21-7 -> 28117-21-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Grandisol not found on commonchemistry - Grandisol

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC([C@]1([H])CC[C@@](C)1CCO)=C
Granulocyte_macrophage_colony-stimulating_factor (5055)
```
Botcommand: addindex 338974683 Granulocyte_macrophage_colony-stimulating_factor
```
```
For index : Granulocyte_macrophage_colony-stimulating_factor=338974683
```
* 83869-56-1 -> 83869-56-1 - NOT VERIFIED

* CAS found on commonchemistry - 83869-56-1 - name not in list
All names: Colony-stimulating factor 2

* Granulocyte+macrophage+colony+stimulating+factor not found on commonchemistry - Granulocyte+macrophage+colony+stimulating+factor

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Grapefruit_mercaptan (5056)
```
Botcommand: addindex 360373891 Grapefruit_mercaptan
```
```
For index : Grapefruit_mercaptan=360373891
```
* 71159-90-5 -> 71159-90-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Grapefruit+mercaptan not found on commonchemistry - Grapefruit+mercaptan

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC1=CC[C@H]([C@](C)(S)C)CC1
Green_S (5057)
```
Botcommand: addindex 353767617 Green_S
```
```
For index : Green_S=353767617
```
* 3087-16-9 -> 3087-16-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Green+S found on commonchemistry - Green+S
* 128-80-3 (Formula: C28H22N2O2; Name: 9,10-Anthracenedione, 1,4-bis[(4-methylphenyl)amino]-)

* 569-64-2 (Formula: C23H25N2.Cl; Name: Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride)

* 633-03-4 (Formula: C27H33N2.HO4S; Name: Ethanaminium, N-[4-[[4-(diethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, sulfate (1:1))

* 1314-13-2 (Formula: OZn; Name: Zinc oxide, (ZnO))

* 1328-53-6 (Formula: Unspecified; Name: C.I. Pigment Green 7)

* 7720-78-7 (Formula: Fe.H2O4S; Name: Sulfuric acid, iron(2+) salt (1:1))

* 10049-14-6 (Formula: F4U; Name: Uranium fluoride, (UF4), (T-4)-)

* 25038-91-9 (Formula: (C8H16O2.C8H6O4.C2H6O2)x; Name: 1,4-Benzenedicarboxylic acid, polymer with 1,4-cyclohexanedimethanol and 1,2-ethanediol)

* No ChemSpiderID

* PubChem: 91525

* No InChI

* SMILES: CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+]
Growth_hormone_releasing_hexapeptide (5060)
```
Botcommand: addindex 349277751 Growth_hormone_releasing_hexapeptide
```
```
For index : Growth_hormone_releasing_hexapeptide=349277751
```
* 87616-84-0 -> 87616-84-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Growth+hormone+releasing+hexapeptide not found on commonchemistry - Growth+hormone+releasing+hexapeptide

* No ChemSpiderID

* PubChem: 5486806

* No InChI

* SMILES: C[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21) C(=O)NC(CC3=CC=CC=C3) C(=O)N[C@@H] (CCCCN)C(=O)N)NC(=O)[C@@H](CC4=CNC5=CC=CC=C54) NC(=O)[C@H](CC6=CN=CN6)N
Grubbs'_catalyst (5061)
```
Botcommand: addindex 340547279 Grubbs'_catalyst
```
```
For index : Grubbs'_catalyst=340547279
```
* 172222-30-9 -> 172222-30-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Grubbs+catalyst found on commonchemistry - Grubbs+catalyst
* 246047-72-3 (exact match)
Name not in list

All names: (1,3-Dimesitylimidazolidin-2-ylidene)(tricyclohexylphosphine)benzylidene ruthenium dichloride, [[[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)ruthenium]], Benzylidene(1,3-dimesitylimidazolidin-2-ylidene)(tricyclohexylphosphine)ruthenium dichloride, [[Benzylidene[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(tricyclohexylphosphine)ruthenium]], Benzylidenedichloro(1,3-dimesitylimidazolidin-2-ylidene)(tricyclohexylphosphine )ruthenium, Dichloro(1,3-dimesityl-4,5-dihydroimidazol-2-ylidene)(phenylmethylene)(tricyclohexylphosphine)ruthenium, [[grubbs catalyst 2nd. generation]], Grubbs II catalyst, Grubbs' Ru-dihydroimidazolylidene catalyst, Grubbs second generation catalyst, Grubbs-Herrmann catalyst, Grubbs-Nolan catalyst, [[Ruthenium, [1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-]], [[Second generation grubbs catalyst]]

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Guaiacolsulfonate (5063)
```
Botcommand: addindex 350272815 Guaiacolsulfonate
```
```
For index : Guaiacolsulfonate=350272815
```
* 50855-43-1 -> 50855-43-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Guaiacolsulfonate not found on commonchemistry - Guaiacolsulfonate

* No ChemSpiderID (correct: 21106318)

* PubChem: 159379

* No InChI

* No SMILES
Guanacastepene_A (5067)
```
Botcommand: addindex 359671945 Guanacastepene_A
```
```
For index : Guanacastepene_A=359671945
```
* 263357-41-1 -> 263357-41-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanacastepene+A not found on commonchemistry - Guanacastepene+A

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C3C2=CC1=C(C=O)[C@@H](O)CC[C@](C)1CC[C@@](C)2[C@@H]([C@@H](C)C)[C@H]3OC(C)=O
Guanadrel (5068)
```
Botcommand: addindex 361692490 Guanadrel
```
```
For index : Guanadrel=361692490
```
* 40580-59-4 -> 40580-59-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanadrel not found on commonchemistry - Guanadrel

* No ChemSpiderID

* PubChem: 38521

* No InChI

* SMILES: C1CCC2(CC1)OCC(O2)CN=C(N)N
Guanazodine (5069)
```
Botcommand: addindex 350933482 Guanazodine
```
```
For index : Guanazodine=350933482
```
* 32059-15-7 -> 32059-15-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanazodine not found on commonchemistry - Guanazodine

* No ChemSpiderID

* PubChem: 36054

* No InChI

* No SMILES
Guanidine_nitrate (5073)
```
Botcommand: addindex 354737569 Guanidine_nitrate
```
```
For index : Guanidine_nitrate=354737569
```
* 506-93-4 -> 506-93-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanidine+nitrate not found on commonchemistry - Guanidine+nitrate

* No ChemSpiderID

* PubChem: 10481

* No InChI

* SMILES: C(=N)(N)N.[N+](=O)(O)[O-]
Guanidinium_thiocyanate (5075)
```
Botcommand: addindex 364277921 Guanidinium_thiocyanate
```
```
For index : Guanidinium_thiocyanate=364277921
```
* 593-84-0 -> 593-84-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanidinium+thiocyanate not found on commonchemistry - Guanidinium+thiocyanate

* No ChemSpiderID

* PubChem: 65046

* No InChI

* SMILES: C(#N)S.C(=N)(N)N
Guanidinopropionic_acid (5076)
File:Guanidinopropionic Acid .pngâ€Ž
```
Botcommand: addindex 355959247 Guanidinopropionic_acid
```
```
For index : Guanidinopropionic_acid=355959247
```
* 353-09-3 -> 353-09-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanidinopropionic+acid not found on commonchemistry - Guanidinopropionic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C(CN=C(N)N)C(=O)O
Guanochlor (5078)
```
Botcommand: addindex 350934440 Guanochlor
```
```
For index : Guanochlor=350934440
```
* 5001-32-1 -> 5001-32-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanochlor not found on commonchemistry - Guanochlor

* No ChemSpiderID

* PubChem: 71835

* No InChI

* No SMILES
Guanosine_diphosphate (5080)
```
Botcommand: addindex 361302534 Guanosine_diphosphate
```
```
For index : Guanosine_diphosphate=361302534
```
* 146-91-8 -> 146-91-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanosine+diphosphate not found on commonchemistry - Guanosine+diphosphate

* No ChemSpiderID

* PubChem: 730

* No InChI

* SMILES: C1=NC2=C(N1C3C(C(C(O3)COP (=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N
Guanosine_diphosphate_mannose (5081)
```
Botcommand: addindex 359066184 Guanosine_diphosphate_mannose
```
```
For index : Guanosine_diphosphate_mannose=359066184
```
* 3123-67-9 -> 3123-67-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanosine+diphosphate+mannose not found on commonchemistry - Guanosine+diphosphate+mannose

* No ChemSpiderID

* PubChem: 18396

* No InChI

* SMILES: C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OC4C(C(C(C(O4)CO)O)O)O)O)O)NC(=NC2=O)N
Guanoxabenz (5084)
```
Botcommand: addindex 350933587 Guanoxabenz
```
```
For index : Guanoxabenz=350933587
```
* 24047-25-4 -> 24047-25-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanoxabenz not found on commonchemistry - Guanoxabenz

* No ChemSpiderID

* PubChem: 9567831

* No InChI

* SMILES: C1=CC(=C(C(=C1)Cl)C=NN=C(N)NO)Cl
Guanoxan (5085)
```
Botcommand: addindex 350934496 Guanoxan
```
```
For index : Guanoxan=350934496
```
* 2165-19-7 -> 2165-19-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Guanoxan not found on commonchemistry - Guanoxan

* No ChemSpiderID

* PubChem: 16564

* No InChI

* No SMILES
Guar_gum (5086)
```
Botcommand: addindex 353996985 Guar_gum
```
```
For index : Guar_gum=353996985
```
* 9000-30-0 -> 9000-30-0 - NOT VERIFIED

* CAS found on commonchemistry - 9000-30-0 - name in list
All names: 1212A, Avicel CE 15, Burtonite V 7E, C 1000, C 1000 (gum), C 250, C 250 (gum), Celbond 7, Celca-Gum D 49D, CG 70, CP 3300, CSAA-M 80, CSA-M 175, Cyamopsis gum, Dealca TP 1, Dealca TP 2, Decorpa, Duck Gum 800, Dycol 4500, E 412, Edicol ULV 50, EGMB, Emcogum CSAA, Emulgum 200, Emulgum 200S, FFH 200, FG-HV, Fine Gum G, Fine Gum G 17, Frimulsion BM, G 50, Galactasol, Galactasol 20H5FI, Galactasol 211, Galactasol 270, Galactasol 30M1F, Galaxy 1083, Gendril Thik, Gendriv 162, goma guar, Gomme de guar, GR 10, Guapack PF 20, Guapack PN, Guar, Guar 5200, Guar flour, Guar gum, Guar gum (cyamopsis tetragonolobus), Guar Gummi, Guar HV 7000 CPS, Guar Supercol U Fine, Guar WW250F, Guaran, Guarcel 302, Guarcol U 40, Guargel D 15, Gum cyamopsis, Gum guar, GUM, GUAR, Gums, guar, GV 23/2, GW 4, GW 4AFG, Herbapeck SF 08, Higum 551, HYDROXYPROPYL GALACTOMANNAN ETHER, Inagel GR 10, Inagel GR 10C, Indalca AG, Indalca AG-BV, Indalca AG-HV, J 2Fp, J 3000, Jaguar, Jaguar 170, Jaguar 2100, Jaguar 2204, Jaguar 2243, Jaguar 2513, Jaguar 2610, Jaguar 2638, Jaguar 387, Jaguar 6000, Jaguar 6003, Jaguar 6003VT, Jaguar 7500X, Jaguar 8200, Jaguar A 20B, Jaguar A 20D, Jaguar A 40F, Jaguar HP 140, Jaguar MDD, Jaguar MDD-I, K 4492, KWL 2000, Lameprint DX 9, Lamgum 200, Lej Guar, LGC 1, Lipocard, Loloss, Lycoid DR, Meyprofin M 175, Meyprogat 30, Meyprogat 7, Meypro-Guar 50, Meypro-Guar CSAA 200/50, Meypro-Guar CSAA-M 225, Meyprogum L, Meyprogum TC 47, Neosoft, Neosoft G 11, Newgelin G 100, NGL 8158, Oruno G 1, PAK-T 80, Papsize 7, PF 20, Polytex 100, Procol F, Procol S 1, Procol U, Rantec 4000, Rantec D 1, Regonol, Rein Guarin, RG 100, RT 3088, Soaguar RG 100, Solvent purified guar gum, Stamulcol ULV 500, Super Tack, Supercol, Supercol G 2H, Supercol G 2S, Supercol GF, Supercol U, Supercol U Powder, Syngum D 46D, Uni-Guar, Uniguar 80, Vidocreme A, Vidogum G 120/1501, Vidogum G 200-1, Vidogum GH 175, Vidogum GHK 175, VIS TOP B 20, VIS TOP D 1321, VIS TOP D 20, VIS TOP D 2022, VIS TOP D 2029, VIS TOP LH 303, Viscogum BCR 13/80, Viscogum HV 100T, Viscogum HV 3000, Viscogum HV 3000A, VLV, WG 15, WG 19, WG 1L, WOGU 4401, X 5363, Î±-D-Galactopyrano-Î²-D-mannopyranan, Î±-D-galacto-Î²-D-Mannan

* Guar+gum found on commonchemistry - Guar+gum
* 9000-30-0 (Formula: Unspecified; Name: Guar gum) Matches CAS (9000-30-0) on page

* 39421-75-5 (Formula: C3H8O2.xUnspecified; Name: Guar gum, 2-hydroxypropyl ether)

* 65497-29-2 (Formula: C6H16NO2.xCl.xUnspecified; Name: Guar gum, 2-hydroxy-3-(trimethylammonio)propyl ether, chloride)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Guggulsterone (5087)
```
Botcommand: addindex 363079424 Guggulsterone
```
```
For index : Guggulsterone=363079424
```
* 95975-55-6 -> 95975-55-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Guggulsterone not found on commonchemistry - Guggulsterone

* No ChemSpiderID

* PubChem: 6439929

* No InChI

* SMILES: (E): O=C1C[C@@]2([H])[C@]3([H])CCC4=CC(CC[C@]4(C)[C@@]3([H])CC[C@]2(C)/C1=C\C)=O (Z): O=C1C[C@@]2([H])[C@]3([H])CCC4=CC(CC[C@]4(C)[C@@]3([H])CC[C@]2(C)/C1=C/C)=O
Guibourtinidin (5088)

* No CASNo

* Guibourtinidin not found on commonchemistry - Guibourtinidin

* No ChemSpiderID

* PubChem: 20481741

* No InChI

* SMILES: C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=[O+]2)O)O)O
Guibourtinidol (5089)

* No CASNo

* Guibourtinidol not found on commonchemistry - Guibourtinidol

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: Oc1ccc(cc1)C2Oc3cc(O)ccc3CC2O
Gulose (5090)
```
Botcommand: addindex 355960183 Gulose
```
```
For index : Gulose=355960183
```
* 4205-23-6 -> 4205-23-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Gulose not found on commonchemistry - Gulose

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)C(CO)O1
Gusperimus (5091)
```
Botcommand: addindex 317859883 Gusperimus
```
```
For index : Gusperimus=317859883
```
* 84937-45-1 -> 84937-45-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Gusperimus not found on commonchemistry - Gusperimus

* No ChemSpiderID

* PubChem: 91271

* No InChI

* No SMILES
Gyrinal (5092)
```
Botcommand: addindex 355683799 Gyrinal
```
```
For index : Gyrinal=355683799
```
* 36518-11-3 -> 36518-11-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Gyrinal not found on commonchemistry - Gyrinal

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [H]C(=O)\C=C(/C)CC\C=C(/C)C(=O)\C=C\C(C)=O
Gyromitrin (5093)
```
Botcommand: addindex 363361989 Gyromitrin
```
```
For index : Gyromitrin=363361989
```
* 16568-02-8 -> 16568-02-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Gyromitrin not found on commonchemistry - Gyromitrin

* No ChemSpiderID

* PubChem: 9548611

* InChI: 1/C4H8N2O/c1-3-5-6(2)4-7/h3-4H,1-2H3/b5-3+

* SMILES: C/C=N/N(C)C=O
H-89 (5094)
```
Botcommand: addindex 336589568 H-89
```
```
For index : H-89=336589568
```
* 127243-85-0 -> 127243-85-0 - NOT VERIFIED

* CAS not found on commonchemistry

* H found on commonchemistry - H
* 50-00-0 (Formula: CH2O; Name: Formaldehyde)

* 50-01-1 (Formula: CH5N3.ClH; Name: Guanidine, monohydrochloride)

* 50-02-2 (Formula: C22H29FO5; Name: Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11Î²,16Î±)-)

* 50-03-3 (Formula: C23H32O6; Name: Pregn-4-ene-3,20-dione, 21-(acetyloxy)-11,17-dihydroxy-, (11Î²)-)

* 50-04-4 (Formula: C23H30O6; Name: Pregn-4-ene-3,11,20-trione, 21-(acetyloxy)-17-hydroxy-)

* 50-06-6 (Formula: C12H12N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl-)

* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-09-9 (Formula: C12H16N2O3.Na; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl-, sodium salt)

* 50-10-2 (Formula: C21H34NO3.Br; Name: Ethanaminium, 2-[(cyclohexylhydroxyphenylacetyl)oxy]-N,N-diethyl-N-methyl-, bromide)

* 50-11-3 (Formula: C9H14N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diethyl-1-methyl-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: c1cc2cnccc2c(c1)S(=O)(=O)NCCNC/C=C/c3ccc(cc3)Br.O.O.Cl.Cl
HBT_(explosive) (5095)
```
Botcommand: addindex 348890998 HBT_(explosive)
```
```
For index : HBT_(explosive)=348890998
```
* 74999-19-2 -> 74999-19-2 - NOT VERIFIED

* CAS not found on commonchemistry

* HBT+explosive not found on commonchemistry - HBT+explosive

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(NNC2=NN=NN2)=NN=NN1
HDMP-28 (5096)

* No CASNo

* HDMP not found on commonchemistry - HDMP

* No ChemSpiderID

* PubChem: 9817261

* No InChI

* No SMILES
HEPPS (5098)
```
Botcommand: addindex 348472753 HEPPS
```
```
For index : HEPPS=348472753
```
* 16052-06-5 -> 16052-06-5 - NOT VERIFIED

* CAS not found on commonchemistry

* HEPPS not found on commonchemistry - HEPPS

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1CN(CCN1CCCS(=O)(=O)O)CCO
HMG-CoA (5099)
```
Botcommand: addindex 332039873 HMG-CoA
```
```
For index : HMG-CoA=332039873
```
* 1553-55-5 -> 1553-55-5 - NOT VERIFIED

* CAS not found on commonchemistry

* HMG+CoA not found on commonchemistry - HMG+CoA

* No ChemSpiderID

* PubChem: 84

* No InChI

* No SMILES

5101 to 5150

HOT-17 (5101)
```
Botcommand: addindex 353733821 HOT-17
```
```
For index : HOT-17=353733821
```
* 207740-40-7 -> 207740-40-7 - NOT VERIFIED

* CAS not found on commonchemistry

* HOT found on commonchemistry - HOT
* 50-56-6 (Formula: C43H66N12O12S2; Name: Oxytocin)

* 55-55-0 (Formula: C7H9NO.1/2H2O4S; Name: Phenol, 4-(methylamino)-, sulfate (2:1) (salt))

* 59-05-2 (Formula: C20H22N8O5; Name: L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-)

* 60-99-1 (Formula: C19H24N2OS; Name: 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,Î²-trimethyl-, (Î²R)-)

* 64-31-3 (Formula: C17H19NO3.1/2H2O4S; Name: Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl- (5Î±,6Î±)-, sulfate (2:1) (salt))

* 68-19-9 (Formula: C63H88CoN14O14P; Name: Vitamin B12)

* 72-54-8 (Formula: C14H10Cl4; Name: Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro-)

* 78-11-5 (Formula: C5H8N4O12; Name: 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, dinitrate (ester))

* 79-57-2 (Formula: C22H24N2O9; Name: 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)-)

* 86-35-1 (Formula: C11H12N2O2; Name: 2,4-Imidazolidinedione, 3-ethyl-5-phenyl-)

* No ChemSpiderID (correct: 21106319)

* No PubChem

* No InChI

* SMILES: COC1=CC(CCNO)=C(OC)C=C1SC(C)CC
HOT-2 (5102)
```
Botcommand: addindex 353733787 HOT-2
```
```
For index : HOT-2=353733787
```
* 207740-38-3 -> 207740-38-3 - NOT VERIFIED

* CAS not found on commonchemistry

* HOT found on commonchemistry - HOT
* 50-56-6 (Formula: C43H66N12O12S2; Name: Oxytocin)

* 55-55-0 (Formula: C7H9NO.1/2H2O4S; Name: Phenol, 4-(methylamino)-, sulfate (2:1) (salt))

* 59-05-2 (Formula: C20H22N8O5; Name: L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-)

* 60-99-1 (Formula: C19H24N2OS; Name: 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,Î²-trimethyl-, (Î²R)-)

* 64-31-3 (Formula: C17H19NO3.1/2H2O4S; Name: Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl- (5Î±,6Î±)-, sulfate (2:1) (salt))

* 68-19-9 (Formula: C63H88CoN14O14P; Name: Vitamin B12)

* 72-54-8 (Formula: C14H10Cl4; Name: Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro-)

* 78-11-5 (Formula: C5H8N4O12; Name: 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, dinitrate (ester))

* 79-57-2 (Formula: C22H24N2O9; Name: 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)-)

* 86-35-1 (Formula: C11H12N2O2; Name: 2,4-Imidazolidinedione, 3-ethyl-5-phenyl-)

* No ChemSpiderID (correct: 21106320)

* No PubChem

* No InChI

* SMILES: C1(=CC(=C(C=C1CCNO)OC)SCC)OC
HOT-7 (5103)
```
Botcommand: addindex 353733550 HOT-7
```
```
For index : HOT-7=353733550
```
* 207740-39-4 -> 207740-39-4 - NOT VERIFIED

* CAS not found on commonchemistry

* HOT found on commonchemistry - HOT
* 50-56-6 (Formula: C43H66N12O12S2; Name: Oxytocin)

* 55-55-0 (Formula: C7H9NO.1/2H2O4S; Name: Phenol, 4-(methylamino)-, sulfate (2:1) (salt))

* 59-05-2 (Formula: C20H22N8O5; Name: L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-)

* 60-99-1 (Formula: C19H24N2OS; Name: 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,Î²-trimethyl-, (Î²R)-)

* 64-31-3 (Formula: C17H19NO3.1/2H2O4S; Name: Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl- (5Î±,6Î±)-, sulfate (2:1) (salt))

* 68-19-9 (Formula: C63H88CoN14O14P; Name: Vitamin B12)

* 72-54-8 (Formula: C14H10Cl4; Name: Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro-)

* 78-11-5 (Formula: C5H8N4O12; Name: 1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, dinitrate (ester))

* 79-57-2 (Formula: C22H24N2O9; Name: 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)-)

* 86-35-1 (Formula: C11H12N2O2; Name: 2,4-Imidazolidinedione, 3-ethyl-5-phenyl-)

* No ChemSpiderID (correct: 21106321)

* No PubChem

* No InChI

* SMILES: C1(=CC(=C(C=C1CCNO)OC)SCCC)OC
HPV_vaccine (5104)

* No CASNo

* HPV+vaccine not found on commonchemistry - HPV+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
HT-0712 (5105)
```
Botcommand: addindex 345528857 HT-0712
```
```
For index : HT-0712=345528857
```
* 617720-02-2 -> 617720-02-2 - NOT VERIFIED

* CAS not found on commonchemistry

* HT found on commonchemistry - HT
* 1332-58-7 (Formula: Unspecified; Name: Kaolin)

* 50-02-2 (Formula: C22H29FO5; Name: Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11Î²,16Î±)-)

* 50-35-1 (Formula: C13H10N2O4; Name: 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-)

* 50-67-9 (Formula: C10H12N2O; Name: 1H-Indol-5-ol, 3-(2-aminoethyl)-)

* 51-21-8 (Formula: C4H3FN2O2; Name: 2,4(1H,3H)-Pyrimidinedione, 5-fluoro-)

* 52-68-6 (Formula: C4H8Cl3O4P; Name: Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester)

* 53-39-4 (Formula: C19H30O3; Name: Cyclopenta[5,6]naphtho[1,2-c]pyran-2(1H)-one, tetradecahydro-7-hydroxy-4a,6a,7-trimethyl-, (4aS,4bS,6aS,7S,9aS,9bR,11aS)-)

* 54-42-2 (Formula: C9H11IN2O5; Name: Uridine, 2'-deoxy-5-iodo-)

* 55-48-1 (Formula: C17H23NO3.1/2H2O4S; Name: Benzeneacetic acid, Î±-(hydroxymethyl)- (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, sulfate (2:1) (salt))

* 56-55-3 (Formula: C18H12; Name: Benz[a]anthracene)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
HU-210 (5106)
```
Botcommand: addindex 362866357 HU-210
```
```
For index : HU-210=362866357
```
* 112830-95-2 -> 112830-95-2 - NOT VERIFIED

* CAS not found on commonchemistry

* HU found on commonchemistry - HU
* 127-07-1 (Formula: CH4N2O2; Name: Urea, hydroxy-)

* 51-30-9 (Formula: C11H17NO3.ClH; Name: 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride)

* 51-41-2 (Formula: C8H11NO3; Name: 1,2-Benzenediol, 4-[(1R)-2-amino-1-hydroxyethyl]-)

* 53-73-6 (Formula: C49H70N14O11; Name: Angiotensin II, 1-L-asparagine-5-L-valine-)

* 56-41-7 (Formula: C3H7NO2; Name: L-Alanine)

* 56-94-0 (Formula: C32H52N4O4.2Br; Name: Benzenaminium, 3,3'-[1,10-decanediylbis[(methylimino)carbonyloxy]]bis[N,N,N-trimethyl-, dibromide)

* 57-11-4 (Formula: C18H36O2; Name: Octadecanoic acid)

* 57-55-6 (Formula: C3H8O2; Name: 1,2-Propanediol)

* 58-82-2 (Formula: C50H73N15O11; Name: Bradykinin)

* 58-89-9 (Formula: C6H6Cl6; Name: Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1Î±,2Î±,3Î²,4Î±,5Î±,6Î²)-)

* No ChemSpiderID (correct: 21106322)

* PubChem: 9821569

* No InChI

* No SMILES
HU-308 (5107)
```
Botcommand: addindex 355283223 HU-308
```
```
For index : HU-308=355283223
```
* 256934-39-1 -> 256934-39-1 - NOT VERIFIED

* CAS not found on commonchemistry

* HU found on commonchemistry - HU
* 127-07-1 (Formula: CH4N2O2; Name: Urea, hydroxy-)

* 51-30-9 (Formula: C11H17NO3.ClH; Name: 1,2-Benzenediol, 4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-, hydrochloride)

* 51-41-2 (Formula: C8H11NO3; Name: 1,2-Benzenediol, 4-[(1R)-2-amino-1-hydroxyethyl]-)

* 53-73-6 (Formula: C49H70N14O11; Name: Angiotensin II, 1-L-asparagine-5-L-valine-)

* 56-41-7 (Formula: C3H7NO2; Name: L-Alanine)

* 56-94-0 (Formula: C32H52N4O4.2Br; Name: Benzenaminium, 3,3'-[1,10-decanediylbis[(methylimino)carbonyloxy]]bis[N,N,N-trimethyl-, dibromide)

* 57-11-4 (Formula: C18H36O2; Name: Octadecanoic acid)

* 57-55-6 (Formula: C3H8O2; Name: 1,2-Propanediol)

* 58-82-2 (Formula: C50H73N15O11; Name: Bradykinin)

* 58-89-9 (Formula: C6H6Cl6; Name: Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1Î±,2Î±,3Î²,4Î±,5Î±,6Î²)-)

* No ChemSpiderID

* PubChem: 5311172

* No InChI

* No SMILES
HYDIA (5108)

* No CASNo

* HYDIA not found on commonchemistry - HYDIA

* No ChemSpiderID

* PubChem: 9794223

* No InChI

* No SMILES
HZ-2 (5109)
```
Botcommand: addindex 358178207 HZ-2
```
```
For index : HZ-2=358178207
```
* 253304-60-8 -> 253304-60-8 - NOT VERIFIED

* CAS not found on commonchemistry

* HZ found on commonchemistry - HZ
* 78-67-1 (Formula: C8H12N4; Name: Propanenitrile, 2,2'-azobis[2-methyl-)

* 123-77-3 (Formula: C2H4N4O2; Name: Diazenedicarboxamide)

* 1071-76-7 (Formula: C4H10O.1/4Zr; Name: 1-Butanol, zirconium(4+) salt)

* 1314-23-4 (Formula: O2Zr; Name: Zirconium oxide, (ZrO2))

* 1332-29-2 (Formula: Unspecified; Name: Tin oxide)

* 9002-88-4 (Formula: (C2H4)x; Name: Ethene, homopolymer)

* 9002-98-6 (Formula: (C2H5N)x; Name: Aziridine, homopolymer)

* 9003-07-0 (Formula: (C3H6)x; Name: 1-Propene, homopolymer)

* 9004-36-8 (Formula: C4H8O2.xC2H4O2.xUnspecified; Name: Cellulose, acetate butanoate)

* 9025-57-4 (Formula: Unspecified; Name: Xylanase, endo-1,4-Î²-)

* No ChemSpiderID

* PubChem: 356604

* No InChI

* No SMILES
Hachimycin (5110)

* No CASNo

* Hachimycin not found on commonchemistry - Hachimycin

* No ChemSpiderID

* PubChem: 11979956

* No InChI

* No SMILES
Haematopodin (5111)

* No CASNo

* Haematopodin not found on commonchemistry - Haematopodin

* ChemSpiderID: 10473906 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C13H12N2O3/c16-9-5-8-11-7(6-14-12(11)13(9)17)4-10-15(8)2-â€‹1-3-18-10/h5-6,10,14H,1-4H2/t10-/m1/s1 - (ChemSpider: | InChI=InChI=1/C13H12N2O3/c16-9-5-8-11-7(6-14-12(11)13(9)17)4-10-15(8)2-1-3-18-10/h5-6,10,14H,1-4H2/t10-/m1/s1 )

* SMILES: O=C3/C=C2/N4CCCO[C@@H]4Cc1cnc(c12)C3=O - (ChemSpider: | SMILES=O=C3/C=C2/N4CCCO[C@@H]4Cc1cnc(c12)C3=O )
Haematopodin_B (5112)

* No CASNo

* Haematopodin+B not found on commonchemistry - Haematopodin+B

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Haematoxylin (5113)
```
Botcommand: addindex 354960395 Haematoxylin
```
```
For index : Haematoxylin=354960395
```
* 517-28-2 -> 517-28-2 - NOT VERIFIED

* CAS found on commonchemistry - 517-28-2 - name in list
All names: (+)-Hematoxylin, [[7,11b-Dihydrobenz[b]indeno[1,2-b]pyran-3,4,6a,9,10(6H)-pentol]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS-cis)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, cis-(+)-]], haematoxylin, HAEMATOXYLINE POWDER, hematoxilina, Hematoxylin, Hematoxyline, Hematoxyline, Hydroxybrasilin, Hydroxybrazilin, NSC 270085

* Haematoxylin found on commonchemistry - Haematoxylin
* 517-28-2 (exact match) Matches CAS (517-28-2) on page
Name in list

All names: (+)-Hematoxylin, [[7,11b-Dihydrobenz[b]indeno[1,2-b]pyran-3,4,6a,9,10(6H)-pentol]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS-cis)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, cis-(+)-]], [[haematoxylin]], [[haematoxylinE POWDER]], hematoxilina, Hematoxylin, Hematoxyline, Hematoxyline, Hydroxybrasilin, Hydroxybrazilin, NSC 270085

* No ChemSpiderID

* PubChem: 10603

* No InChI

* SMILES: Oc2cc3CC4(O)COc1c(O)c(O)ccc1C4c3cc2O
Hafnium(IV)_carbide (5115)
```
Botcommand: addindex 364300739 Hafnium(IV)_carbide
```
```
For index : Hafnium(IV)_carbide=364300739
```
* 12069-85-1 -> 12069-85-1 - NOT VERIFIED

* CAS found on commonchemistry - 12069-85-1 - name not in list
All names: Carbure d'hafnium, carburo de hafnio, hafnium carbide, Hafnium carbide (HfC), Hafnium monocarbide, Hafnium monocarbide (HfC), Hafniumcarbid

* Hafnium+IV+carbide not found on commonchemistry - Hafnium+IV+carbide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Halcinonide (5119)
```
Botcommand: addindex 362723630 Halcinonide
```
```
For index : Halcinonide=362723630
```
* 3093-35-4 -> 3093-35-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Halcinonide not found on commonchemistry - Halcinonide

* No ChemSpiderID

* PubChem: 18342

* No InChI

* No SMILES
Halofuginone (5121)
```
Botcommand: addindex 341848960 Halofuginone
```
```
For index : Halofuginone=341848960
```
* 55837-20-2 -> 55837-20-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Halofuginone not found on commonchemistry - Halofuginone

* No ChemSpiderID

* PubChem: 62891

* No InChI

* No SMILES
Halometasone (5122)
```
Botcommand: addindex 342045694 Halometasone
```
```
For index : Halometasone=342045694
```
* 50629-82-8 -> 50629-82-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Halometasone not found on commonchemistry - Halometasone

* No ChemSpiderID

* PubChem: 39745

* No InChI

* No SMILES
Halomon (5123)
```
Botcommand: addindex 358329972 Halomon
```
```
For index : Halomon=358329972
```
* 142439-86-9 -> 142439-86-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Halomon not found on commonchemistry - Halomon

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C)(Cl)[C@H](Br)CC[C@](CBr)(Cl)C(Cl)=C
Haloxazolam (5127)
```
Botcommand: addindex 347856544 Haloxazolam
```
```
For index : Haloxazolam=347856544
```
* 59128-97-1 -> 59128-97-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Haloxazolam not found on commonchemistry - Haloxazolam

* No ChemSpiderID

* PubChem: 3563

* No InChI

* No SMILES
Harmaline (5128)
```
Botcommand: addindex 362817293 Harmaline
```
```
For index : Harmaline=362817293
```
* 304-21-2 -> 304-21-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Harmaline not found on commonchemistry - Harmaline

* No ChemSpiderID

* PubChem: 5280951

* No InChI

* SMILES: CC1=C2C(=C3C=CC (=CC3=N2)OC)CCN1
Harmine (5129)
```
Botcommand: addindex 362869429 Harmine
```
```
For index : Harmine=362869429
```
* 442-51-3 -> 442-51-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Harmine not found on commonchemistry - Harmine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC1=NC=CC2=C1NC3 =C2C=CC(=C3)OC
Hasubanan (5130)
```
Botcommand: addindex 343512074 Hasubanan
```
```
For index : Hasubanan=343512074
```
* 14510-67-9 -> 14510-67-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Hasubanan not found on commonchemistry - Hasubanan

* No ChemSpiderID

* PubChem: 6857499

* No InChI

* SMILES: C1CC[C@]23CCC4=CC= CC=C4[C@@]2(C1)CCN3
Hasubanonine (5131)
```
Botcommand: addindex 343513584 Hasubanonine
```
```
For index : Hasubanonine=343513584
```
* 1805-85-2 -> 1805-85-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hasubanonine not found on commonchemistry - Hasubanonine

* No ChemSpiderID

* PubChem: 442246

* No InChI

* SMILES: CN4[C@@](CC2)3[C@@] (CC(C(OC)=C3OC)=O) (CC4)C1=C2C=CC(OC)=C1OC
Hawkinsin (5132)

* No CASNo

* Hawkinsin not found on commonchemistry - Hawkinsin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hederagenin (5134)
```
Botcommand: addindex 356152780 Hederagenin
```
```
For index : Hederagenin=356152780
```
* 465-99-6 -> 465-99-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hederagenin not found on commonchemistry - Hederagenin

* No ChemSpiderID

* PubChem: 472.69

* No InChI

* No SMILES
Helenalin (5135)
```
Botcommand: addindex 357875387 Helenalin
```
```
For index : Helenalin=357875387
```
* 6754-13-8 -> 6754-13-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Helenalin not found on commonchemistry - Helenalin

* No ChemSpiderID

* PubChem: 23205

* No InChI

* SMILES: CC1CC2C(C(C3(C1C=CC3=O)C)O)C(=C)C(=O)O2
Hematein (5136)
```
Botcommand: addindex 349035690 Hematein
```
```
For index : Hematein=349035690
```
* 475-25-2 -> 475-25-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hematein not found on commonchemistry - Hematein

* No ChemSpiderID

* PubChem: 10138

* No InChI

* SMILES: C1C2=CC(=O)C(=CC2=C3C1(COC4=C3C=CC(=C4O)O)O)O
Hematoporphyrin (5137)
```
Botcommand: addindex 348922218 Hematoporphyrin
```
```
For index : Hematoporphyrin=348922218
```
* 14459-29-1 -> 14459-29-1 - NOT VERIFIED

* CAS found on commonchemistry - 14459-29-1 - name in list
All names: 1,3,5,8-Tetramethyl-2,4-bis(Î±-hydroxyethyl)porphine-6,7-dipropionic acid, 2,18-Porphinedipropionic acid, 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-, 21H,23H-Porphine-2,18-dipropanoic acid, 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-, 7,12-Bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-2,18-porphinedipropionic acid, haematoporphyrin, hematoporfirina, Hematoporphyrin, Hematoporphyrin IX, hematoporphyrine, HP, HpIX, NSC 267084, NSC 59265, Photodyn

* Hematoporphyrin found on commonchemistry - Hematoporphyrin
* 14459-29-1 (exact match) Matches CAS (14459-29-1) on page
Name in list

All names: 1,3,5,8-Tetramethyl-2,4-bis(Î±-hydroxyethyl)porphine-6,7-dipropionic acid, 2,18-Porphinedipropionic acid, 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-, 21H,23H-Porphine-2,18-dipropanoic acid, 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-, 7,12-Bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-2,18-porphinedipropionic acid, haematoporphyrin, hematoporfirina, [[hematoporphyrin]], [[hematoporphyrin IX]], [[hematoporphyrine]], HP, HpIX, NSC 267084, NSC 59265, Photodyn

* ChemSpiderID: 10632 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 11103

* No InChI - (ChemSpider: | InChI=InChI=1/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13- )

* No SMILES - (ChemSpider: | smiles=O=C(O)CCC=5c2nc(cc4c(c(c(cc1c(c(c(n1)cc/3nc(c2)\C(=C\3C)CCC(=O)O)C(O)C)C)n4)C(O)C)C)C=5C )
Heme_C (5138)
```
Botcommand: addindex 355979509 Heme_C
```
```
For index : Heme_C=355979509
```
* 26598-29-8 -> 26598-29-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Heme+C found on commonchemistry - Heme+C
* 16009-13-5 (exact match)
Name in list

All names: 1,3,5,8-Tetramethyl-2,4-divinylporphine-6,7-dipropionic acid ferrichloride, [[Chloro[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]iron]], Chlorohemin, Chloroprotoferriheme, Chloroprotohemin, [[Ferrate(2-), chloro[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24]-, dihydrogen, (SP-5-13)-]], [[Ferrate(2-), chloro[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-ÎºN21,ÎºN22,ÎºN23,ÎºN24]-, dihydrogen, (SP-5-13)-]], [[Ferrate(2-), chloro[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-ÎºN21,ÎºN22,ÎºN23,ÎºN24]-, hydrogen (1:2), (SP-5-13)-]], Ferric hemin, Ferriheme, [[Ferriheme chloride]], Ferriporphyrin chloride, Ferriprotoporphyrin, Ferriprotoporphyrin IX, Ferriprotoporphyrin IX chloride, Haemin, hemin, Hemin chloride, Hemin IX, hemina, Hemine, Iron(III) protoporphyrin chloride, [[Iron, chloro[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]-]], KJB 003, Panhematin, Protoferriheme, Protohemin, Protohemin chloride, Protohemin IX, Teichmann's crystals

* No ChemSpiderID

* PubChem: 444125

* No InChI

* No SMILES
Heme_a (5139)
```
Botcommand: addindex 363039980 Heme_a
```
```
For index : Heme_a=363039980
```
* 18535-39-2 -> 18535-39-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Heme+a not found on commonchemistry - Heme+a

* No ChemSpiderID

* PubChem: 5288529

* No InChI

* No SMILES
Heme_arginate (5140)
```
Botcommand: addindex 346555050 Heme_arginate
```
```
For index : Heme_arginate=346555050
```
* 100438-92-4 -> 100438-92-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Heme+arginate not found on commonchemistry - Heme+arginate

* No ChemSpiderID

* PubChem: 3086464

* No InChI

* No SMILES
Heme_o (5142)
```
Botcommand: addindex 268937422 Heme_o
```
```
For index : Heme_o=268937422
```
* 137397-56-9 -> 137397-56-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Heme+o not found on commonchemistry - Heme+o

* No ChemSpiderID

* PubChem: 6323367

* No InChI

* No SMILES
Hemicholinium-3 (5143)
```
Botcommand: addindex 352300135 Hemicholinium-3
```
```
For index : Hemicholinium-3=352300135
```
* 312-45-8 -> 312-45-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Hemicholinium not found on commonchemistry - Hemicholinium

* No ChemSpiderID

* PubChem: 3585

* No InChI

* No SMILES
Hemopressin (5145)

* No CASNo

* Hemopressin not found on commonchemistry - Hemopressin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hentriacontane (5146)
```
Botcommand: addindex 347132819 Hentriacontane
```
```
For index : Hentriacontane=347132819
```
* 630-04-6 -> 630-04-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hentriacontane not found on commonchemistry - Hentriacontane

* No ChemSpiderID

* PubChem: 12410

* No InChI

* SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
Hentriacontylic_acid (5147)
```
Botcommand: addindex 362540994 Hentriacontylic_acid
```
```
For index : Hentriacontylic_acid=362540994
```
* 38232-01-8 -> 38232-01-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Hentriacontylic+acid not found on commonchemistry - Hentriacontylic+acid

* No ChemSpiderID

* PubChem: 37982

* No InChI

* SMILES: OC(CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC)=O
Heparin (5148)
```
Botcommand: addindex 365220707 Heparin
```
```
For index : Heparin=365220707
```
* 9005-49-6 -> 9005-49-6 - NOT VERIFIED

* CAS found on commonchemistry - 9005-49-6 - name in list
All names: Ardeparin, Arteven, Bemiparin, Centaxarin, Certoparin, Clevarin, Clivarin, Clivarine, CY 216, CY 222, Dalteparin, Deligoparin, Fluxum, FR 860, Fragmin A, Fragmin B, Fraxiparin, Gammaparin, H 5284, H 9399, Hapacarin, Heparin, Heparin subcutan, Heparin sulfate, heparina, Heparine, Heparinic acid, KB 101, Leparan, Livaracine, M 118REH, Mono-embolex, Multiparin, Nadroparin, Nadroparine, Novoheparin, Octaparin, OP 386, OP 622, Pabyrn, Parnaparin, Parvoparin, Reviparin, Sandoparin, Subeparin, Sublingula, Tinzaparin, Triofiban, Vetren, Vitrum AB, Î±-Heparin

* Heparin found on commonchemistry - Heparin
* 9005-49-6 (Formula: W99; Name: Heparin) Matches CAS (9005-49-6) on page

* 9000-94-6 (Formula: Unspecified; Name: Antithrombin)

* 9001-62-1 (Formula: Unspecified; Name: Lipase, triacylglycerol)

* 9004-02-8 (Formula: Unspecified; Name: Lipase, lipoprotein)

* 9041-08-1 (Formula: Unspecified; Name: Heparin, sodium salt)

* 24967-94-0 (Formula: H2O4S.xUnspecified; Name: Dermatan, hydrogen sulfate (ester))

* ChemSpiderID: 17216115 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 772

* No InChI - (ChemSpider: | InChI=InChI=1/C26H41NO34S4/c1-4(28)27-7-9(30)8(29)6(2-52-63(43,44)45)53-24(7)56-15-10(31)11(32)25(58-19(15)21(36)37)55-13-5(3-62(40,41)42)14(60-64(46,47)48)26(59-22(13)38)57-16-12(33)17(61-65(49,50)51)23(39)54-18(16)20(34)35/h5-19,22-26,29-33,38-39H,2-3H2,1H3,(H,27,28)(H,34,35)(H,36,37)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)/t5-,6+,7+,8+,9+,10+,11+,12-,13-,14+,15-,16-,17+,18+,19-,22-,23?,24+,25+,26-/m0/s1 )

* No SMILES
Hepatitis_A_vaccine (5149)
* No CASNo

* Hepatitis+A+vaccine not found on commonchemistry - Hepatitis+A+vaccine

* No ChemSpiderID

* PubChem: 85154227

* No InChI

* No SMILES
Hepatitis_B_immune_globulin (5150)
* No CASNo

* Hepatitis+B+immune+globulin not found on commonchemistry - Hepatitis+B+immune+globulin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

5151 to 5200

Hepatitis_B_vaccine (5151)
* No CASNo

* Hepatitis+B+vaccine not found on commonchemistry - Hepatitis+B+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hepoxilin (5152)
```
Botcommand: addindex 335458563 Hepoxilin
```
```
For index : Hepoxilin=335458563
```
* 94161-11-2 -> 94161-11-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hepoxilin not found on commonchemistry - Hepoxilin

* No ChemSpiderID

* PubChem: 5353666

* No InChI

* SMILES: CCCCCC=CCC1C(O1)C=CC(CC=CCCCC(=O)O)O
Heptabarbital (5153)
```
Botcommand: addindex 332053330 Heptabarbital
```
```
For index : Heptabarbital=332053330
```
* 509-86-4 -> 509-86-4 - NOT VERIFIED

* CAS found on commonchemistry - 509-86-4 - name in list
All names: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohepten-1-yl)-5-ethyl-, 5-(1-Cyclohepten-1-yl)-5-ethyl-2,4,6(1H,3H,5H)-pyrimidinetrione, 5-(1-Cyclohepten-1-yl)-5-ethylbarbituric acid, 5-(1-Cycloheptenyl)-5-ethylbarbiturate, 5-Ethyl-5-(1'-cycloheptenyl)-barbituric acid, 5-Ethyl-5-(1-cycloheptenyl)barbituric acid, Barbituric acid, 5-(1-cyclohepten-1-yl)-5-ethyl-, G 475, heptabarb, heptabarbe, Heptabarbital, Heptabarbitone, heptabarbo, Heptabarbum, Heptadorm, Heptamal, Medapan, Medomin, Medomine, Noctyn

* Heptabarbital found on commonchemistry - Heptabarbital
* 509-86-4 (exact match) Matches CAS (509-86-4) on page
Name in list

All names: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohepten-1-yl)-5-ethyl-, 5-(1-Cyclohepten-1-yl)-5-ethyl-2,4,6(1H,3H,5H)-pyrimidinetrione, 5-(1-Cyclohepten-1-yl)-5-ethylbarbituric acid, 5-(1-Cycloheptenyl)-5-ethylbarbiturate, 5-Ethyl-5-(1'-cycloheptenyl)-barbituric acid, 5-Ethyl-5-(1-cycloheptenyl)barbituric acid, Barbituric acid, 5-(1-cyclohepten-1-yl)-5-ethyl-, G 475, heptabarb, heptabarbe, [[heptabarbital]], Heptabarbitone, heptabarbo, Heptabarbum, Heptadorm, Heptamal, Medapan, Medomin, Medomine, Noctyn

* No ChemSpiderID

* PubChem: 10518

* No InChI

* No SMILES
Heptafluorobutyric_acid (5157)
```
Botcommand: addindex 350085850 Heptafluorobutyric_acid
```
```
For index : Heptafluorobutyric_acid=350085850
```
* 375-22-4 -> 375-22-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Heptafluorobutyric+acid not found on commonchemistry - Heptafluorobutyric+acid

* No ChemSpiderID

* PubChem: 9777

* No InChI

* SMILES: OC(C(F)(F)C(F)(F)C(F)(F)F)=O
Heptalene (5158)
```
Botcommand: addindex 361662228 Heptalene
```
```
For index : Heptalene=361662228
```
* 257-24-9 -> 257-24-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Heptalene not found on commonchemistry - Heptalene

* No ChemSpiderID

* PubChem: 5460725

* No InChI

* SMILES: C1=CC=C2C=CC=CC=C2C=C1
Heptaminol (5159)
```
Botcommand: addindex 357372469 Heptaminol
```
```
For index : Heptaminol=357372469
```
* 372-66-7 -> 372-66-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Heptaminol not found on commonchemistry - Heptaminol

* No ChemSpiderID

* PubChem: 3590

* No InChI

* SMILES: CC(C)(O)CCCC(N)C
Heptanitrocubane (5162)
```
Botcommand: addindex 360871642 Heptanitrocubane
```
```
For index : Heptanitrocubane=360871642
```
* 99393-62-1 -> 99393-62-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Heptanitrocubane not found on commonchemistry - Heptanitrocubane

* No ChemSpiderID

* PubChem: 11732527

* No InChI

* SMILES: C12C3(C4(C1(C5(C2(C3(C45[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
Heptyl_acetate (5164)
```
Botcommand: addindex 287126239 Heptyl_acetate
```
```
For index : Heptyl_acetate=287126239
```
* 112-06-1 -> 112-06-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Heptyl+acetate not found on commonchemistry - Heptyl+acetate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCCCCCCOC(=O)C
Hepzidine (5165)
```
Botcommand: addindex 358792178 Hepzidine
```
```
For index : Hepzidine=358792178
```
* 1096-72-6 -> 1096-72-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hepzidine not found on commonchemistry - Hepzidine

* ChemSpiderID: 63761 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 70593

* No InChI - (ChemSpider: | InChI=InChI=1/C21H25NO/c1-22-14-12-18(13-15-22)23-21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21/h2-9,18,21H,10-15H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O(C3c1ccccc1CCc2ccccc23)C4CCN(C)CC4 )
Herbacetin (5166)
```
Botcommand: addindex 350556716 Herbacetin
```
```
For index : Herbacetin=350556716
```
* 527-95-7 -> 527-95-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Herbacetin not found on commonchemistry - Herbacetin

* No ChemSpiderID

* PubChem: 5280544

* No InChI

* SMILES: C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O
Herbimycin (5167)
```
Botcommand: addindex 346364150 Herbimycin
```
```
For index : Herbimycin=346364150
```
* 70563-58-5 -> 70563-58-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Herbimycin not found on commonchemistry - Herbimycin

* No ChemSpiderID

* PubChem: 6436247

* No InChI

* No SMILES
Herkinorin (5168)

* No CASNo

* Herkinorin not found on commonchemistry - Herkinorin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hernandulcin (5169)
```
Botcommand: addindex 355685687 Hernandulcin
```
```
For index : Hernandulcin=355685687
```
* 95602-94-1 -> 95602-94-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hernandulcin not found on commonchemistry - Hernandulcin

* No ChemSpiderID

* PubChem: 125608

* No InChI

* SMILES: CC1=CC(=O)[C@@H](CC1)[C@](C)(CCC=C(C)C)O
Herniarin (5170)
```
Botcommand: addindex 348272601 Herniarin
```
```
For index : Herniarin=348272601
```
* 531-59-9 -> 531-59-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Herniarin not found on commonchemistry - Herniarin

* No ChemSpiderID

* PubChem: 10748

* No InChI

* SMILES: COC1=CC2=C(C=C1)C=CC(=O)O2
Hesperidin (5173)
```
Botcommand: addindex 354574214 Hesperidin
```
```
For index : Hesperidin=354574214
```
* 520-26-3 -> 520-26-3 - NOT VERIFIED

* CAS found on commonchemistry - 520-26-3 - name in list
All names: (2S)-Hesperidin, [[4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (2S)-]], [[4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (S)-]], [[7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one]], Atripliside B, Cirantin, Flavanone, 3',5,7-trihydroxy-4'-methoxy-, 7-(6-O-Î±-L-rhamnosyl-D-glucoside), Hesperetin 7-rhamnoglucoside, Hesperetin 7-rutinoside, hesperidin, hesperidina, Hesperidine, hesperidine, Hesperidoside, NSC 44184

* Hesperidin found on commonchemistry - Hesperidin
* 520-26-3 (exact match) Matches CAS (520-26-3) on page
Name in list

All names: [[(2S)-hesperidin]], [[4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (2S)-]], [[4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (S)-]], [[7-[[6-O-(6-deoxy-Î±-L-mannopyranosyl)-Î²-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one]], Atripliside B, Cirantin, Flavanone, 3',5,7-trihydroxy-4'-methoxy-, 7-(6-O-Î±-L-rhamnosyl-D-glucoside), Hesperetin 7-rhamnoglucoside, Hesperetin 7-rutinoside, [[hesperidin]], [[hesperidina]], [[hesperidine]], [[hesperidine]], Hesperidoside, NSC 44184

* No ChemSpiderID

* PubChem: 10621

* No InChI

* No SMILES
Hetacillin (5174)

* No CASNo

* Hetacillin found on commonchemistry - Hetacillin
* 3511-16-8 (exact match)
Name in list

All names: [[4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-(2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl)-3,3-dimethyl-7-oxo-, [2S-[2Î±,5Î±,6Î²(S*)]]-]], [[4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-(2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl)-3,3-dimethyl-7-oxo-, D-(-)-]], [[4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[(4R)-2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl]-3,3-dimethyl-7-oxo-, (2S,5R,6R)-]], BL-P 804, BRL 804, Etacillin, hetacilina, [[hetacillin]], [[hetacilline]], Penplenum, Phenazacillin, Versapen, Versatrex, Vimocilin

* No ChemSpiderID

* PubChem: 3596

* No InChI

* No SMILES
Heterocodeine (5175)
File:Heterocodeine.png
```
Botcommand: addindex 343863058 Heterocodeine
```
```
For index : Heterocodeine=343863058
```
* 639-47-4 -> 639-47-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Heterocodeine not found on commonchemistry - Heterocodeine

* No ChemSpiderID

* PubChem: 5462505

* No InChI

* No SMILES
Hexabromocyclododecane (5176)
```
Botcommand: addindex 363283522 Hexabromocyclododecane
```
```
For index : Hexabromocyclododecane=363283522
```
* 25637-99-4 -> 25637-99-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexabromocyclododecane found on commonchemistry - Hexabromocyclododecane
* 3194-55-6 (exact match)
Name in list

All names: [[1,2,5,6,9,10- hexabromocyclododecane]], 1,2,5,6,9,10-Heaxbromocyclododecane hbcd, 1,2,5,6,9,10-Hexabromcyclodecan, 1,2,5,6,9,10-hexabromociclodecano, 1,2,5,6,9,10-Hexabromocyclodecane, [[1,2,5,6,9,10-hexabromocyclododecane]], Bromkal 73-6D, Cyclododecane, 1,2,5,6,9,10-hexabromo-, CYCLODODECANE, 12,5,6,9,10-HEXABROMO-, FR 1206, FR 1206HT, [[hexabromocyclododecane]], Pyroguard SR 104, SR 104, YM 88A

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(Br)C(Br)CCC(Br)C(Br)CCC(Br)C(Br)CC1
Hexacene (5177)
```
Botcommand: addindex 359939426 Hexacene
```
```
For index : Hexacene=359939426
```
* 258-31-1 -> 258-31-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexacene not found on commonchemistry - Hexacene

* No ChemSpiderID

* PubChem: 123044

* No InChI

* SMILES: C1=CC=C2C=C3C=C4C=C5C=C6C=CC=CC6=CC5=CC4=CC3=CC2=C1
Hexachloroacetone (5178)
```
Botcommand: addindex 323285888 Hexachloroacetone
```
```
For index : Hexachloroacetone=323285888
```
* 116-16-5 -> 116-16-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexachloroacetone not found on commonchemistry - Hexachloroacetone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl
Hexachlorocyclopentadiene (5181)
```
Botcommand: addindex 354930855 Hexachlorocyclopentadiene
```
```
For index : Hexachlorocyclopentadiene=354930855
```
* 77-47-4 -> 77-47-4 - NOT VERIFIED

* CAS found on commonchemistry - 77-47-4 - name in list
All names: 1,2,3,4,5,5-Hexachloro-1,3-cyclopentadiene, 1,2,3,4,5,5-Hexachlorocyclopentadiene, 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro-, C 56, CYCLOPENTADIENE, HEXACHLORO-, Graphlox, Hexachlorcyclopentadien, Hexachloro-1,3-cyclopentadiene, hexachlorocyclopentadiene, Hexachlorocyclopentadiene, hexaclorociclopentadieno, HRS 1655, NSC 9235, Perchlorocyclopentadiene, UN 2646

* Hexachlorocyclopentadiene found on commonchemistry - Hexachlorocyclopentadiene
* 77-47-4 (Formula: C5Cl6; Name: 1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro-) Matches CAS (77-47-4) on page

* 2385-85-5 (Formula: C10Cl12; Name: 1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexachlorophenol (5184)
```
Botcommand: addindex 265856958 Hexachlorophenol
```
```
For index : Hexachlorophenol=265856958
```
* 599-52-0 -> 599-52-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexachlorophenol not found on commonchemistry - Hexachlorophenol

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1C(=C(Cl)C(Cl)(Cl)C(=C1Cl)Cl)Cl
Hexacyanochromate(II) (5186)
* No CASNo

* Hexacyanochromate+II not found on commonchemistry - Hexacyanochromate+II

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexacyclonate (5187)
```
Botcommand: addindex 349756908 Hexacyclonate
```
```
For index : Hexacyclonate=349756908
```
* 7491-42-1 -> 7491-42-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexacyclonate not found on commonchemistry - Hexacyclonate

* No ChemSpiderID

* PubChem: 23444

* No InChI

* No SMILES
Hexadecacarbonylhexarhodium (5188)
```
Botcommand: addindex 315484425 Hexadecacarbonylhexarhodium
```
```
For index : Hexadecacarbonylhexarhodium=315484425
```
* 28407-51-4 -> 28407-51-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexadecacarbonylhexarhodium not found on commonchemistry - Hexadecacarbonylhexarhodium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexafluoro-2-butyne (5190)
```
Botcommand: addindex 265820307 Hexafluoro-2-butyne
```
```
For index : Hexafluoro-2-butyne=265820307
```
* 692-50-2 -> 692-50-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexafluoro+butyne not found on commonchemistry - Hexafluoro+butyne

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: FC(F)(F)C#CC(F)(F)F
Hexafluorophosphoric_acid (5195)
```
Botcommand: addindex 358376730 Hexafluorophosphoric_acid
```
```
For index : Hexafluorophosphoric_acid=358376730
```
* 16940-81-1 -> 16940-81-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexafluorophosphoric+acid not found on commonchemistry - Hexafluorophosphoric+acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: F[PH](F)(F)(F)(F)F
Hexafluoropropylene_oxide (5197)
```
Botcommand: addindex 316524128 Hexafluoropropylene_oxide
```
```
For index : Hexafluoropropylene_oxide=316524128
```
* 428-59-1 -> 428-59-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexafluoropropylene+oxide not found on commonchemistry - Hexafluoropropylene+oxide

* No ChemSpiderID

* PubChem: 9883

* No InChI

* SMILES: C1(C(O1)(F)F)(C(F)(F)F)F
Hexafluronium_bromide (5199)
```
Botcommand: addindex 360531147 Hexafluronium_bromide
```
```
For index : Hexafluronium_bromide=360531147
```
* 4844-10-4 -> 4844-10-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexafluronium+bromide found on commonchemistry - Hexafluronium+bromide
* 317-52-2 (exact match)
Name in list

All names: 1,6-Hexanediaminium, N,N'-di-9H-fluoren-9-yl-N,N,N',N'-tetramethyl-, dibromide, 1,6-Hexanediaminium, N1,N6-di-9H-fluoren-9-yl-N1,N1,N6,N6-tetramethyl-, bromide (1:2), [[Ammonium, hexamethylenebis[fluoren-9-yldimethyl-, dibromide]], B 141, bromure d'hexafluronium, bromuro de hexafluronio, Hexafluorenium bromide, Hexafluorenium dibromide, [[hexafluronium bromide]], Hexafluroniumbromid, Hexamethylenebis(9-fluorenyldimethylammonium) dibromide, [[Hexamethylenebis[dimethyl-9-fluorenylammonium bromide]]], [[Hexamethylenebis[fluoren-9-yldimethylammonium bromide]]], Mylaxen

* No ChemSpiderID

* PubChem: 9434

* No InChI

* No SMILES
Hexahydroxy-1,4-naphthalenedione (5200)
```
Botcommand: addindex 346360371 Hexahydroxy-1,4-naphthalenedione
```
```
For index : Hexahydroxy-1,4-naphthalenedione=346360371
```
* 476-37-9 -> 476-37-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexahydroxy+naphthalenedione not found on commonchemistry - Hexahydroxy+naphthalenedione

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(C1=C2C(O)=C(O)C(O)=C1O)C(O)=C(O)C2=O

5201 to 5250

Hexahydroxy-2,3-naphthalenedione (5201)

* No CASNo

* Hexahydroxy+naphthalenedione not found on commonchemistry - Hexahydroxy+naphthalenedione

* No ChemSpiderID

* PubChem: 9816469

* No InChI

* SMILES: C12=C(C(=O)C(=O)C(=C1C(=C(C(=C2O)O)O)O)O)O
Hexahydroxybenzene_triscarbonate (5202)

* No CASNo

* Hexahydroxybenzene+triscarbonate not found on commonchemistry - Hexahydroxybenzene+triscarbonate

* No ChemSpiderID

* PubChem: 13382132

* No InChI

* SMILES: C12=C(C3=C(C4=C1OC(=O)O4)OC(=O)O3)OC(=O)O2
Hexahydroxybenzene_trisoxalate (5203)

* No CASNo

* Hexahydroxybenzene+trisoxalate not found on commonchemistry - Hexahydroxybenzene+trisoxalate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexamethonium (5204)
```
Botcommand: addindex 360368421 Hexamethonium
```
```
For index : Hexamethonium=360368421
```
* 60-26-4 -> 60-26-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexamethonium not found on commonchemistry - Hexamethonium

* ChemSpiderID: 3478 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3604

* No InChI - (ChemSpider: | InChI=InChI=1/C12H30N2/c1-13(2,3)11-9-7-8-10-12-14(4,5)6/h7-12H2,1-6H3/q+2 )

* No SMILES - (ChemSpider: | smiles=C(CCCC[N+](C)(C)C)C[N+](C)(C)C )
Hexamethylene_triperoxide_diamine (5208)
```
Botcommand: addindex 350329969 Hexamethylene_triperoxide_diamine
```
```
For index : Hexamethylene_triperoxide_diamine=350329969
```
* 283-66-9 -> 283-66-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexamethylene+triperoxide+diamine not found on commonchemistry - Hexamethylene+triperoxide+diamine

* No ChemSpiderID

* PubChem: 61101

* No InChI

* SMILES: N1(COOCN2COOC1)COOC2
Hexamethyltungsten (5211)
```
Botcommand: addindex 360804445 Hexamethyltungsten
```
```
For index : Hexamethyltungsten=360804445
```
* 36133-73-0 -> 36133-73-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexamethyltungsten not found on commonchemistry - Hexamethyltungsten

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexamidine (5212)
```
Botcommand: addindex 341840029 Hexamidine
```
```
For index : Hexamidine=341840029
```
* 3811-75-4 -> 3811-75-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexamidine found on commonchemistry - Hexamidine
* 125-33-7 (exact match)
Name in list

All names: 2-Deoxyphenobarbital, 2-Desoxyphenobarbital, 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-phenyl-, 5-Ethyl-5-phenylhexahydropyrimidine-4,6-dione, 5-Ethyldihydro-5-phenyl-4,6(1H,5H)-pyrimidinedione, 5-Ethylhexahydro-5-phenylpyrimidine-4,6-dione, 5-Phenyl-5-ethyl-hexahydropyrimidine-4,6-dione, [[hexamidine]], [[hexamidine (antiepileptic)]], Hexamydin, Lepimidin, Liskantin, Milepsin, Misodine, Misolyne, Mizodin, Mizolin, Mylepsin, Mysedon, Mysoline, Neurosyn, NSC 41701, Primaclone, Primacone, Primakton, Primidon, primidona, Primidone, Pyrimidone Medi-pets, Resimatil, Roe 101, Sertan

* No ChemSpiderID

* PubChem: 65130

* No InChI

* SMILES: C1=CC(=CC=C1C(=N)N)OCCCCCCOC2=CC=C(C=C2)C(=N)N
Hexamminecobalt(III)_chloride (5214)
```
Botcommand: addindex 345532551 Hexamminecobalt(III)_chloride
```
```
For index : Hexamminecobalt(III)_chloride=345532551
```
* 10534-89-1 -> 10534-89-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexamminecobalt+III+chloride not found on commonchemistry - Hexamminecobalt+III+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexanitrobenzene (5219)

* No CASNo

* Hexanitrobenzene not found on commonchemistry - Hexanitrobenzene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexanitrodiphenylamine (5220)
```
Botcommand: addindex 364180935 Hexanitrodiphenylamine
```
```
For index : Hexanitrodiphenylamine=364180935
```
* 131-73-7 -> 131-73-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexanitrodiphenylamine not found on commonchemistry - Hexanitrodiphenylamine

* No ChemSpiderID

* PubChem: 8576

* No InChI

* SMILES: C1=C(C=C(C(=C1[N+](=O)[O-])NC2=C(C=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
Hexanitroethane (5221)
```
Botcommand: addindex 353624666 Hexanitroethane
```
```
For index : Hexanitroethane=353624666
```
* 918-37-6 -> 918-37-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexanitroethane not found on commonchemistry - Hexanitroethane

* No ChemSpiderID

* PubChem: 61232

* No InChI

* SMILES: C(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]
Hexanitrostilbene (5222)
```
Botcommand: addindex 363021761 Hexanitrostilbene
```
```
For index : Hexanitrostilbene=363021761
```
* 20062-22-0 -> 20062-22-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexanitrostilbene not found on commonchemistry - Hexanitrostilbene

* No ChemSpiderID

* PubChem: 253628

* No InChI

* SMILES: O=[N+](c1cc([N+]([O-])=O)c(/C=C/c2c ([N+]([O-])=O)cc([N+]([O-])=O)cc2[N+] ([O-])=O)c([N+]([O-])=O)c1)[O-]
Hexaphenylbenzene (5225)
```
Botcommand: addindex 360716967 Hexaphenylbenzene
```
```
For index : Hexaphenylbenzene=360716967
```
* 992-04-1 -> 992-04-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexaphenylbenzene not found on commonchemistry - Hexaphenylbenzene

* ChemSpiderID: 63611 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 70432

* No InChI - (ChemSpider: | InChI=InChI=1/C42H30/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)40(34-25-13-4-14-26-34)42(36-29-17-6-18-30-36)41(35-27-15-5-16-28-35)39(37)33-23-11-3-12-24-33/h1-30H )

* SMILES: C1=CC=C(C=C1)C2=C(C(=C(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 - (ChemSpider: | SMILES=c1cc(ccc1)c3c(c(c(c(c3c2ccccc2)c4ccccc4)c5ccccc5)c6ccccc6)c7ccccc7 )
Hexapropymate (5226)
```
Botcommand: addindex 361801391 Hexapropymate
```
```
For index : Hexapropymate=361801391
```
* 358-52-1 -> 358-52-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexapropymate not found on commonchemistry - Hexapropymate

* No ChemSpiderID

* PubChem: 9661

* No InChI

* No SMILES
Hexatriacontanoic_acid (5227)

* No CASNo

* Hexatriacontanoic+acid not found on commonchemistry - Hexatriacontanoic+acid

* No ChemSpiderID

* PubChem: 5282596

* No InChI

* SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O
Hexazine (5228)
File:Hexazine by Kryptid.jpg

* No CASNo

* Hexazine not found on commonchemistry - Hexazine

* No ChemSpiderID

* PubChem: 11966278

* InChI: 1S/N6/c1-2-4-6-5-3-1

* SMILES: n1=nn=nn=n1
Hexazinone (5229)
```
Botcommand: addindex 362153605 Hexazinone
```
```
For index : Hexazinone=362153605
```
* 51235-04-2 -> 51235-04-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexazinone not found on commonchemistry - Hexazinone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(N1C2CCCCC2)N=C(N(C)C)N(C)C1=O
Hexethal (5230)
```
Botcommand: addindex 295961690 Hexethal
```
```
For index : Hexethal=295961690
```
* 144-00-3 -> 144-00-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexethal not found on commonchemistry - Hexethal

* No ChemSpiderID

* PubChem: 152092

* No InChI

* No SMILES
Hexetidine (5231)
```
Botcommand: addindex 353601080 Hexetidine
```
```
For index : Hexetidine=353601080
```
* 141-94-6 -> 141-94-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexetidine not found on commonchemistry - Hexetidine

* No ChemSpiderID

* PubChem: 3607

* No InChI

* No SMILES
Hexobendine (5233)

* No CASNo

* Hexobendine not found on commonchemistry - Hexobendine

* No ChemSpiderID

* PubChem: 5777

* No InChI

* No SMILES
Hexocyclium (5234)
```
Botcommand: addindex 360223534 Hexocyclium
```
```
For index : Hexocyclium=360223534
```
* 6004-98-4 -> 6004-98-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexocyclium not found on commonchemistry - Hexocyclium

* No ChemSpiderID

* PubChem: 24199

* No InChI

* No SMILES
Hexol (5235)
* No CASNo

* Hexol found on commonchemistry - Hexol
* 58-89-9 (Formula: C6H6Cl6; Name: Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1Î±,2Î±,3Î²,4Î±,5Î±,6Î²)-)

* 87-89-8 (Formula: C6H12O6; Name: myo-Inositol)

* 144-11-6 (Formula: C20H31NO; Name: 1-Piperidinepropanol, Î±-cyclohexyl-Î±-phenyl-)

* 409-21-2 (Formula: CSi; Name: Silicon carbide, (SiC))

* 66108-95-0 (Formula: C19H26I3N3O9; Name: 1,3-Benzenedicarboxamide, 5-[acetyl(2,3-dihydroxypropyl)amino]-N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hexoprenaline (5236)
```
Botcommand: addindex 341743760 Hexoprenaline
```
```
For index : Hexoprenaline=341743760
```
* 3215-70-1 -> 3215-70-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexoprenaline not found on commonchemistry - Hexoprenaline

* No ChemSpiderID

* PubChem: 3609

* No InChI

* No SMILES
Hexyl_cinnamaldehyde (5237)
```
Botcommand: addindex 315690007 Hexyl_cinnamaldehyde
```
```
For index : Hexyl_cinnamaldehyde=315690007
```
* 101-86-0 -> 101-86-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexyl+cinnamaldehyde not found on commonchemistry - Hexyl+cinnamaldehyde

* No ChemSpiderID

* PubChem: 1550884

* No InChI

* SMILES: CCCCCC/C(=C\C1=CC=CC=C1)/C=O
Hexylcaine (5238)
```
Botcommand: addindex 353740859 Hexylcaine
```
```
For index : Hexylcaine=353740859
```
* 532-77-4 -> 532-77-4 - NOT VERIFIED

* CAS found on commonchemistry - 532-77-4 - name in list
All names: 1-(Cyclohexylamino)-2-propanol benzoate ester, 1-Cyclohexylamino-2-propyl benzoate, 2-Cyclohexylamino-1-methylethyl benzoate, 2-Propanol, 1-(cyclohexylamino)-, 2-benzoate, 2-Propanol, 1-(cyclohexylamino)-, benzoate, 2-Propanol, 1-(cyclohexylamino)-, benzoate (ester), Cyclain, Hexylcaine, Osmocaine

* Hexylcaine found on commonchemistry - Hexylcaine
* 532-77-4 (exact match) Matches CAS (532-77-4) on page
Name in list

All names: 1-(Cyclohexylamino)-2-propanol benzoate ester, 1-Cyclohexylamino-2-propyl benzoate, 2-Cyclohexylamino-1-methylethyl benzoate, 2-Propanol, 1-(cyclohexylamino)-, 2-benzoate, 2-Propanol, 1-(cyclohexylamino)-, benzoate, 2-Propanol, 1-(cyclohexylamino)-, benzoate (ester), Cyclain, [[hexylcaine]], Osmocaine

* No ChemSpiderID

* PubChem: 10770

* No InChI

* No SMILES
Hexylresorcinol (5239)
```
Botcommand: addindex 364873613 Hexylresorcinol
```
```
For index : Hexylresorcinol=364873613
```
* 136-77-6 -> 136-77-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Hexylresorcinol not found on commonchemistry - Hexylresorcinol

* No ChemSpiderID

* PubChem: 3610

* No InChI

* No SMILES
Hib_vaccine (5240)
* No CASNo

* Hib+vaccine not found on commonchemistry - Hib+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Hidrosmin (5241)
```
Botcommand: addindex 314108039 Hidrosmin
```
```
For index : Hidrosmin=314108039
```
* 115960-14-0 -> 115960-14-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hidrosmin not found on commonchemistry - Hidrosmin

* No ChemSpiderID

* PubChem: 3087722

* No InChI

* No SMILES
Higenamine (5242)
```
Botcommand: addindex 360798643 Higenamine
```
```
For index : Higenamine=360798643
```
* 5843-65-2 -> 5843-65-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Higenamine not found on commonchemistry - Higenamine

* No ChemSpiderID

* PubChem: 114840

* No InChI

* SMILES: C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O
Himbacine (5243)
```
Botcommand: addindex 355983551 Himbacine
```
```
For index : Himbacine=355983551
```
* 6879-74-9 -> 6879-74-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Himbacine not found on commonchemistry - Himbacine

* No ChemSpiderID

* PubChem: 6436265

* No InChI

* No SMILES
Hinokitiol (5244)
```
Botcommand: addindex 355685970 Hinokitiol
```
```
For index : Hinokitiol=355685970
```
* 499-44-5 -> 499-44-5 - NOT VERIFIED

* CAS found on commonchemistry - 499-44-5 - name in list
All names: 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-(1-methylethyl)-, 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-isopropyl-, 2-hidroxi-4-isopropil-2,4,6-ciclohepta-2,4,6-trien-1-ona, 2-Hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-trien-1-on, 2-Hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-trien-1-one, 2-hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-triene-1-one, 2-Hydroxy-4-isopropyl-2,4,6-cycloheptatrien-1-one, 4-Isopropyltropolone, 6-Isopropyltropolone, Hinokitiol, HT-SF, Hyka 1, IPT, Kisei Pro-Sol N, NSC 18804, S-HT, Î²-Isopropyltropolon, Î²-Thujaplicin, Î²-Thujaplicine

* Hinokitiol found on commonchemistry - Hinokitiol
* 499-44-5 (exact match) Matches CAS (499-44-5) on page
Name in list

All names: 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-(1-methylethyl)-, 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-isopropyl-, 2-hidroxi-4-isopropil-2,4,6-ciclohepta-2,4,6-trien-1-ona, 2-Hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-trien-1-on, 2-Hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-trien-1-one, 2-hydroxy-4-isopropyl-2,4,6-cyclohepta-2,4,6-triene-1-one, 2-Hydroxy-4-isopropyl-2,4,6-cycloheptatrien-1-one, 4-Isopropyltropolone, 6-Isopropyltropolone, [[hinokitiol]], HT-SF, Hyka 1, IPT, Kisei Pro-Sol N, NSC 18804, S-HT, Î²-Isopropyltropolon, Î²-Thujaplicin, Î²-Thujaplicine

* No ChemSpiderID

* PubChem: 3611

* No InChI

* SMILES: CC(C)C1=CC(=O)C(=CC=C1)O
Hipposudoric_acid (5245)
```
Botcommand: addindex 346363795 Hipposudoric_acid
```
```
For index : Hipposudoric_acid=346363795
```
* 851367-73-2 -> 851367-73-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Hipposudoric+acid not found on commonchemistry - Hipposudoric+acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(C=C(CC(O)=O)C3=O)C2=C3C(C1=C2C(O)=O)=C(O)C=CC1=O
Hippuristanol (5247)
```
Botcommand: addindex 265799117 Hippuristanol
```
```
For index : Hippuristanol=265799117
```
* 80442-78-0 -> 80442-78-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Hippuristanol not found on commonchemistry - Hippuristanol

* No ChemSpiderID

* PubChem: 5205637

* No InChI

* SMILES: [H][C@@]23CC[C@@]1([H])C[C@H](O)CC[C@@](C)1[C@]([H])2[C@@H](O)C[C@@]4(C)[C@@](C[C@@]5([H])[C@@]([H])4[C@](O)(C)[C@]6(C[C@H](C)C(C)(C)O6)O5)3[H]
Hirsutidin (5248)
```
Botcommand: addindex 346665018 Hirsutidin
```
```
For index : Hirsutidin=346665018
```
* 4092-66-4 -> 4092-66-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Hirsutidin not found on commonchemistry - Hirsutidin

* No ChemSpiderID

* PubChem: 441694

* No InChI

* SMILES: COC1=CC2=[O+]C(=C(C=C2C(=C1)O)O)C3=CC(=C(C(=C3)OC)O)OC
Histamine_trifluoromethyl_toluidide (5250)
```
Botcommand: addindex 360227144 Histamine_trifluoromethyl_toluidide
```
```
For index : Histamine_trifluoromethyl_toluidide=360227144
```
* 103827-16-3 -> 103827-16-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Histamine+trifluoromethyl+toluidide not found on commonchemistry - Histamine+trifluoromethyl+toluidide

* No ChemSpiderID

* PubChem: 124846

* No InChI

* SMILES: CC(CCCCC(=O)NC1=CC=C(C=C1)C(F)(F)F)NCCC2=CN=CN2

User:Beetstra/listing21

Contents

Data

5001 to 5050

5051 to 5100

5101 to 5150

5151 to 5200

5201 to 5250