Wikipedia:WikiProject Pharmacology/Log/2009-08-21

Standard header for logs from CheMoBot

01:40:15 (3, 2, 4) (EDIT) User:Nbauman (contribs, talk) edited Tamoxifen (diff, hist)
Added links: http://content.nejm.org/cgi/content/full/361/8/766
02:03:16 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'realboxname' ('drugbox' -> '')
02:03:16 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'boxname' ('drugbox' -> '')
02:03:16 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'image' ('Amlodipine Structural Formulae.png' -> '')
02:03:16 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ChemSpiderID' ('2077' -> '')
02:03:17 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'bioavailability' ('64 to 90%' -> '')
02:03:17 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'metabolism' ('[[Liver|Hepatic]]' -> '')
02:03:17 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'elimination_half-life' ('30 to 50 hours' -> '')
02:03:17 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'excretion' ('[[Kidney|Renal]]' -> '')
02:03:18 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'pregnancy_AU' ('C' -> '')
02:03:18 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'pregnancy_US' ('C' -> '')
02:03:18 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'legal_UK' ('POM' -> '')
02:03:18 (2, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'legal_US' ('Rx-only' -> '')
02:03:19 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'IUPAC_name' ('3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate' -> '')
02:03:19 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'molecular_weight' ('408.879 g/mol' -> '')
02:03:19 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'DrugBank' ('APRD00520' -> '')
02:03:20 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ATC_prefix' ('C08' -> '')
02:03:20 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ATC_suffix' ('CA01' -> '')
02:03:20 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'smiles' ('NCCOCC1=C(C(=O)OCC)C(C(=C(C)N1)C(=O)OC)c1ccccc1Cl' -> '')
02:03:20 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'C' ('20' -> '')
02:03:21 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'H' ('25' -> '')
02:03:21 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'N' ('2' -> '')
02:03:21 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'O' ('5' -> '')
02:03:21 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'Cl' ('1' -> '')
02:03:22 (4, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'PubChem' ('2162' -> '')
02:03:22 (5, 3, 5) (EDIT) User:60.52.15.251 (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'CAS_number' ('88150-42-9' -> '')
02:15:25 (3, 2, 4) (EDIT) User:CardioMD (contribs, talk) edited Nebivolol (diff, hist)
Added links: http://adisonline.com/cardiovascular/pages/articleviewer.aspx?year=2009&issue=09040&article=00004&type=abstract
02:47:12 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
02:47:13 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
02:47:13 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'image' ('' -> 'Amlodipine Structural Formulae.png')
02:47:13 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '2077')
02:47:14 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'bioavailability' ('' -> '64 to 90%')
02:47:14 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'metabolism' ('' -> '[[Liver|Hepatic]]')
02:47:14 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'elimination_half-life' ('' -> '30 to 50 hours')
02:47:15 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'excretion' ('' -> '[[Kidney|Renal]]')
02:47:15 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'pregnancy_AU' ('' -> 'C')
02:47:15 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'pregnancy_US' ('' -> 'C')
02:47:16 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'legal_UK' ('' -> 'POM')
02:47:16 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'legal_US' ('' -> 'Rx-only')
02:47:16 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'error' ('empty' -> '')
02:47:16 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'IUPAC_name' ('' -> '3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate')
02:47:17 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'molecular_weight' ('' -> '408.879 g/mol')
02:47:17 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'DrugBank' ('' -> 'APRD00520')
02:47:17 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'C08')
02:47:18 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'ATC_suffix' ('' -> 'CA01')
02:47:18 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'smiles' ('' -> 'NCCOCC1=C(C(=O)OCC)C(C(=C(C)N1)C(=O)OC)c1ccccc1Cl')
02:47:18 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'C' ('' -> '20')
02:47:19 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'H' ('' -> '25')
02:47:19 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'N' ('' -> '2')
02:47:19 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'O' ('' -> '5')
02:47:20 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'Cl' ('' -> '1')
02:47:20 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'PubChem' ('' -> '2162')
02:47:20 (6, 6, 6) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Changed: 'CAS_number' ('' -> '88150-42-9')
02:47:21 (3, 2, 4) (EDIT) User:Fvasconcellos (contribs, talk) edited Amlodipine (diff, hist)
Added links: http://www.marketwatch.com/news/story/pfizer-loses-court-ruling-norvasc/story.aspx?guid=%7B9819D67E-B76B-431D-835C-FB8D6D8327B7%7D, http://www.norvasc.com, http://emc.medicines.org.uk/emc/assets/c/html/displaydoc.asp?documentid=1466
03:16:14 (2, 3, 5) (EDIT) User:Fubbs (contribs, talk) edited Rosuvastatin (diff, hist)
Changed: 'image2' ('Crestor.png' -> 'Rosuvastatin_3D_Ball_and_Stick.png')
03:16:14 (2, 3, 5) (EDIT) User:Fubbs (contribs, talk) edited Rosuvastatin (diff, hist)
Changed: 'image3' ('' -> 'Crestor.png')
04:31:43 (3, 2, 4) (EDIT) User:Beach4444 (contribs, talk) edited Bupropion (diff, hist)
Added links: http://sites.google.com/site/narimanbmehta/
06:19:11 (3, 2, 4) (EDIT) User:Boghog2 (contribs, talk) edited Tamoxifen (diff, hist)
Added links: http://www.astrazeneca.com/_mshost3690701/content/resources/media/investors/2004-abr-brent-vose-oncology.pdf
08:39:48 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Setiptiline (diff, hist)
Changed: 'IUPAC_name' ('2-methyl-2,3,4,9-tetrahydro-1''H''-dibenzo[3,4:6,7]cyclohepta[1,2-''c'']pyridine' -> '2-methyl-2,3,4,9-tetrahydro-1''H''-dibenzo[3,4:6,7]cyclohepta[1,2-''c'']pyridine')
08:39:48 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Setiptiline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:41:29 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sibrotuzumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:42:26 (3, 2, 4) (EDIT) User:Cantaloupe2 (contribs, talk) edited Cocaine (diff, hist)
Added links: http://www.usdoj.gov/oig/special/9712/appb.htm
08:43:06 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sigmodal (diff, hist)
Changed: 'synonyms' ('Sigmodal, Rectidon' -> '')
08:44:22 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Silodosin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:44:55 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Siltuximab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:45:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Simmondsin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:46:38 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sinomenine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:47:43 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Siplizumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:52:36 (3, 2, 4) (EDIT) User:Anypodetos (contribs, talk) edited Siplizumab (diff, hist)
Added links: http://www.clinicaltrials.gov/ct2/results?term=Siplizumab
08:53:19 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Siramesine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:57:43 (4, 3, 5) (EDIT) User:Karol007 (contribs, talk) edited Tretinoin (diff, hist)
Changed: 'PubChem' ('5538' -> '444795')
09:43:29 (3, 2, 4) (EDIT) User:Peterl (contribs, talk) edited Metronidazole (diff, hist)
Added links: http://www.pfizer.com/pfizer/download/uspi_flagyl_375.pdf
09:52:24 (3, 2, 4) (EDIT) User:Meodipt (contribs, talk) edited CPCA (diff, hist)
Added links: http://dx.doi.org/10.1021/jm0401614, http://dx.doi.org/10.1021/jm060762q, http://dx.doi.org/10.1016/S0028-3908(01)00116-2, http://dx.doi.org/10.1016/S0014-2999(01)00968-2, http://dx.doi.org/10.1016/S0028-3908(02)00056-4, http://dx.doi.org/10.1016/S0014-2999(03)01723-0, http://www.ingentaconnect.com/content/ben/cmc/2003/00000010/00000020/art00003, http://dx.doi.org/10.1016/j.neuropharm.2005.04.016, http://dx.doi.org/10.1016/j.euroneuro.2007.02.007, http://dx.doi.org/10.1021/jm0200153, http://pubs3.acs.org/acs/journals/doilookup?in_doi=10.1021/jm0608614, http://dx.doi.org/10.1021/jm990516x, http://www.nature.com/neuro/journal/v4/n9/abs/nn0901-873.html, http://dx.doi.org/10.1021/jm0303296, http://dx.doi.org/10.1021/jm049544s, http://dx.doi.org/10.1021/jm970025h, http://dx.doi.org/10.1016/S0960-894X(01)00379-1, http://dx.doi.org/10.1021/jm000552s, http://dx.doi.org/10.1021/jm970025h, http://dx.doi.org/10.1021/jm040117o, http://dx.doi.org/10.1016/j.bmcl.2006.03.066, http://dx.doi.org/10.1021/jm050694s, http://dx.d
11:27:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sitafloxacin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:28:20 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sivelestat (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:29:35 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sofalcone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:30:42 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Solabegron (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:31:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Solanezumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:32:19 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Spiperone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:33:10 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Spiradoline (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:35:00 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Spiramide (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:36:05 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Spirobarbital (diff, hist)
Changed: 'synonyms' ('Spirobarbital, 5-spiro-(2'-ethyl-3'-5'-dimethyl-cyclopentyl)barbituric acid' -> '5-spiro-(2'-ethyl-3'-5'-dimethyl-cyclopentyl)barbituric acid')
11:36:05 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Spirobarbital (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:37:10 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
11:37:10 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
11:37:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'image' ('' -> 'Stampidine.png')
11:37:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'Br' ('' -> '1')
11:37:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'P' ('' -> '1')
11:37:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
11:37:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
11:37:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'legal_AU' ('' -> '')
11:37:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'legal_CA' ('' -> '')
11:37:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'legal_UK' ('' -> '')
11:37:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'legal_US' ('' -> '')
11:37:13 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'IUPAC_name' ('' -> 'methyl ''N''-((4-bromophenoxy){[(2''S'',5''R'')-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2''H'')-yl)-2,5-dihydrofuran-2-yl]methoxy}phosphoryl)-D-alaninate')
11:37:13 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'molecular_weight' ('' -> '544.289 g/mol')
11:37:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:37:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'C' ('' -> '20')
11:37:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'H' ('' -> '23')
11:37:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'N' ('' -> '3')
11:37:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'O' ('' -> '8')
11:37:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stampidine (diff, hist)
Changed: 'PubChem' ('' -> '469782')
11:38:34 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Stamulumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:39:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
11:39:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
11:39:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'image' ('' -> 'Staurosporine1.png')
11:39:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
11:39:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
11:39:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'legal_AU' ('' -> '')
11:39:14 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'legal_CA' ('' -> '')
11:39:14 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'legal_UK' ('' -> '')
11:39:14 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'legal_US' ('' -> '')
11:39:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'IUPAC_name' ('' -> '(''9S,10R,11R,13R'')-2,3,10,11,12,13-Hexahydro- 10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy- 1''H'',9''H''-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7] benzodiazonin-1-one')
11:39:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'molecular_weight' ('' -> '466.53 g/mol')
11:39:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:39:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'C' ('' -> '28')
11:39:16 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'H' ('' -> '26')
11:39:16 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'N' ('' -> '4')
11:39:16 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'O' ('' -> '3')
11:39:17 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'PubChem' ('' -> '5280487')
11:39:17 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Staurosporine (diff, hist)
Changed: 'CAS_number' ('' -> '62996-74-1')
11:43:19 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
11:43:19 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
11:43:20 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'image' ('' -> 'Streptolydigin.png')
11:43:20 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'IUPAC_name' ('' -> '2-[4-[6-(1,6-dimethylspiro[8,9-dioxabicyclo[3.3.1]non-3-ene-2,2'-oxirane]-7-yl)-4-methylhepta-2,4-dienoyl]-5-hydroxy-1-(5-hydroxy-6-methyloxan-2-yl)-3-oxo-2H-pyrrol-2-yl]-N-methylpropanamide')
11:43:20 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'molecular_weight' ('' -> '600.708 g/mol')
11:43:21 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:43:21 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'C' ('' -> '32')
11:43:21 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'H' ('' -> '44')
11:43:21 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'N' ('' -> '2')
11:43:22 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'O' ('' -> '9')
11:43:22 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'PubChem' ('' -> '220508')
11:43:22 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Streptolydigin (diff, hist)
Changed: 'CAS_number' ('' -> '7229-50-7')
11:44:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulazepam (diff, hist)
Changed: 'molecular_weight' ('300.81' -> '300.81 g/mol')
11:44:03 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulazepam (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:45:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulfatolamide (diff, hist)
Changed: 'ATC_prefix' ('' -> 'G01')
11:45:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulfatolamide (diff, hist)
Changed: 'ATC_suffix' ('' -> 'AE01')
11:47:17 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
11:47:17 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
11:47:18 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'image' ('' -> 'Sulforidazine.png')
11:47:18 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'image2' ('' -> 'Sulforidazine3d.png')
11:47:18 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'S' ('' -> '2')
11:47:19 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'IUPAC_name' ('' -> '10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfonyl)-10''H''-phenothiazine')
11:47:20 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'molecular_weight' ('' -> '402.575 g/mol')
11:47:21 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:47:22 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'C' ('' -> '21')
11:47:23 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'H' ('' -> '26')
11:47:24 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'N' ('' -> '2')
11:47:25 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'O' ('' -> '2')
11:47:25 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'PubChem' ('' -> '31765')
11:47:26 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulforidazine (diff, hist)
Changed: 'CAS_number' ('' -> '14759-06-9')
11:49:10 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
11:49:10 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
11:49:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'image' ('' -> 'Suritozole.svg')
11:49:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'width' ('' -> '200px')
11:49:11 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'F' ('' -> '1')
11:49:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'S' ('' -> '1')
11:49:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
11:49:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
11:49:12 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'legal_AU' ('' -> '')
11:49:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'legal_CA' ('' -> '')
11:49:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'legal_UK' ('' -> '')
11:49:13 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'legal_US' ('' -> '')
11:49:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'IUPAC_name' ('' -> '5-(3-fluorophenyl)-2,4-dimethyl-2,4-dihydro-3''H''-1,2,4-triazole-3-thione')
11:49:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'molecular_weight' ('' -> '223.269 g/mol')
11:49:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
11:49:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'smiles' ('' -> 'Cn1c(=S)n(C)nc1-c2cccc(F)c2')
11:49:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'C' ('' -> '10')
11:49:15 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'H' ('' -> '10')
11:49:16 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'N' ('' -> '3')
11:49:16 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'PubChem' ('' -> '25431')
11:49:16 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suritozole (diff, hist)
Changed: 'CAS_number' ('' -> '110623-33-1')
12:15:01 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
12:15:01 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
12:15:01 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'image' ('' -> 'Surinabant.png')
12:15:01 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'Br' ('' -> '1')
12:15:02 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
12:15:02 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
12:15:02 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'legal_AU' ('' -> '')
12:15:03 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'legal_CA' ('' -> '')
12:15:03 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'legal_UK' ('' -> '')
12:15:04 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'legal_US' ('' -> '')
12:15:04 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'IUPAC_name' ('' -> '5-(4-bromophenyl)-1-(2,4-dichlorophenyl)-4-ethyl-N-(1-piperidinyl)-1H-pyrazole-3-carboxamide')
12:15:05 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'molecular_weight' ('' -> '522.264 g/mol')
12:15:05 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:15:05 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'smiles' ('' -> 'Clc2cc(Cl)ccc2-n1nc(C(=O)NN4CCCCC4)c(CC)c1-c3ccc(Br)cc3')
12:15:05 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'C' ('' -> '23')
12:15:06 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'H' ('' -> '23')
12:15:06 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'N' ('' -> '4')
12:15:06 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'O' ('' -> '1')
12:15:07 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'Cl' ('' -> '2')
12:15:07 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'PubChem' ('' -> '9849616')
12:15:07 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Surinabant (diff, hist)
Changed: 'CAS_number' ('' -> '288104-79-0')
12:16:14 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suriclone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:16:55 (3, 2, 4) (EDIT) User:78.151.172.67 (contribs, talk) edited Thalidomide (diff, hist)
Added links: http://bi.adisinsight.com/rdi/viewdocument.aspx?render=view&mode=remote&adnm=800004827&PushValidation=121745
12:19:45 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
12:19:46 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
12:19:46 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'image' ('' -> 'Suproclone.svg')
12:19:46 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'width' ('' -> '180')
12:19:47 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'S' ('' -> '2')
12:19:47 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
12:19:47 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
12:19:48 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'legal_AU' ('' -> '')
12:19:48 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'legal_CA' ('' -> '')
12:19:48 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'legal_UK' ('' -> '')
12:19:48 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'legal_US' ('' -> '')
12:19:49 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'IUPAC_name' ('' -> '[6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7- dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl]-4-propanoylpiperazine-1-carboxylate')
12:19:49 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'molecular_weight' ('' -> '520.024 g/mol')
12:19:49 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:19:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'C' ('' -> '22')
12:19:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'H' ('' -> '22')
12:19:50 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'N' ('' -> '5')
12:19:51 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'O' ('' -> '4')
12:19:51 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'Cl' ('' -> '1')
12:19:51 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'PubChem' ('' -> '53696')
12:19:52 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suproclone (diff, hist)
Changed: 'CAS_number' ('' -> '77590-92-2')
12:20:34 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
12:20:34 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
12:20:34 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'image' ('' -> 'suplatast tosilate.png')
12:20:34 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'S' ('' -> '2')
12:20:35 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
12:20:35 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
12:20:36 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'legal_AU' ('' -> '')
12:20:37 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'legal_CA' ('' -> '')
12:20:37 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'legal_UK' ('' -> '')
12:20:37 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'legal_US' ('' -> '')
12:20:38 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'legal_status' ('' -> 'Rx-only')
12:20:38 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'IUPAC_name' ('' -> '(3-{[4-(3-ethoxy-2-hydroxypropoxy)phenyl]amino}-3-oxopropyl)(dimethyl)sulfonium 4-methylbenzenesulfonate')
12:20:39 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'molecular_weight' ('' -> '499.64 g/mol')
12:20:39 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
12:20:40 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'smiles' ('' -> 'CCOCC(COC1=CC=C(C=C1)NC(=O)CC[S+](C)C)O.CC1=CC=C(C=C1)S(=O)(=O)[O-]')
12:20:40 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'C' ('' -> '23')
12:20:41 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'H' ('' -> '33')
12:20:41 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'N' ('' -> '1')
12:20:41 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'O' ('' -> '7')
12:20:41 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'PubChem' ('' -> '71773')
12:20:42 (5, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Suplatast_tosilate (diff, hist)
Changed: 'CAS_number' ('' -> '94055-76-2')
13:57:49 (3, 2, 4) (EDIT) User:Nbauman (contribs, talk) edited Tamoxifen (diff, hist)
Added links: http://www.drugstore.com/pharmacy/prices/drugprice.asp?ndc=00093078256&trx=1Z5006
14:53:11 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Sulfonmethane (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:02:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tabimorelin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:04:41 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tadocizumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:05:54 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tafenoquine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:06:53 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Talaporfin (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:07:32 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Talipexole (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:23:52 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Talizumab (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:25:44 (3, 2, 4) (EDIT) User:Fvasconcellos (contribs, talk) edited Mycophenolic_acid (diff, hist)
Added links: http://www.fda.gov/Safety/MedWatch/SafetyInformation/SafetyAlertsforHumanMedicalProducts/ucm177397.htm
15:25:49 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Talnetant (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:26:36 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Tasimelteon (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
15:37:38 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Zomebazam (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
16:16:14 (3, 2, 4) (EDIT) User:OlEnglish (contribs, talk) edited Cocaine (diff, hist)
Added links: http://www.journalstar.com/news/local/article_28e66c86-1ef8-52dc-ac0a-f3933ed6ec5a.html
17:14:12 (3, 2, 4) (EDIT) User:IronAngelAlice (contribs, talk) edited Gardasil (diff, hist)
Added links: http://www.thenation.com/doc/20070326/houppert/2, http://news.independent.co.uk/business/news/article755931.ece, http://www.speroforum.com/site/article.asp?idCategory=33&idsub=128&id=5444&t=GARDASIL+vaccine+touted+in+Michigan
17:18:53 (3, 2, 4) (EDIT) User:Sfishb01 (contribs, talk) edited Varenicline (diff, hist)
Added links: http://www.chantixcases.com
17:35:02 (3, 2, 4) (EDIT) User:70.125.109.247 (contribs, talk) edited Isotretinoin (diff, hist)
Added links: http://web.archive.org/web/20071225182847/http://www.uspharmacist.com/oldformat.asp?url=newlook/files/Feat/apr00iso.cfm&pub_id=8&article_id=508
18:02:34 (3, 2, 4) (EDIT) User:Sfishb01 (contribs, talk) edited Varenicline (diff, hist)
Added links: http://www.chantixcases.com
18:06:26 (3, 2, 4) (EDIT) User:Sfishb01 (contribs, talk) edited Efalizumab (diff, hist)
Added links: http://raptivalegalhelp.com
19:09:17 (4, 3, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Phenprocoumon (diff, hist)
Changed: 'IUPAC_name' ('4-hydroxy-3-(1-phenylpropyl)-2''H''-chromen-2-one' -> '(''RS'')-4-hydroxy-3-(1-phenylpropyl)-2''H''-chromen-2-one')
19:45:08 (3, 2, 4) (EDIT) User:Fvasconcellos (contribs, talk) edited Metformin (diff, hist)
Added links: http://www.medscape.com/viewarticle/707523
20:30:41 (3, 2, 4) (EDIT) User:192.91.173.42 (contribs, talk) edited Acetylcysteine (diff, hist)
Added links: http://www.pubmedcentral.nih.gov/articlerender.fcgi?artid=1533084
21:14:10 (2, 4, 4) (EDIT) User:JÃ¼ (contribs, talk) edited Ketoprofen (diff, hist)
Added: 'image' ('Ketoprofen.svg' -> 'Ketoprofen-Enantiomere Strukturformeln.png', SET '')
22:48:58 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'pregnancy_AU' ('' -> '')
22:48:59 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'pregnancy_US' ('' -> '')
22:48:59 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'legal_AU' ('' -> '')
22:48:59 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'legal_CA' ('Schedule I' -> '')
22:49:00 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'legal_UK' ('Class A' -> '')
22:49:00 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'legal_NL' ('List I' -> '')
22:49:01 (2, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'legal_US' ('Schedule I' -> '')
22:49:01 (4, 3, 5) (EDIT) User:Psychonaught (contribs, talk) edited Alphamethylfentanyl (diff, hist)
Changed: 'molecular_weight' ('350.497 g/mol' -> '')
23:07:50 (3, 2, 4) (EDIT) User:IronAngelAlice (contribs, talk) edited Gardasil (diff, hist)
Added links: http://www.cdc.gov/vaccinesafety/vaers/FDA_and_CDC_Statement.htm